![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | videos/ | 2006-10-04 11:46 | - | |
![[TXT]](/icons/text.gif) | StarCountFormula.txt | 2006-09-17 22:14 | 1.2K | |
![[TXT]](/icons/text.gif) | Aluminum.txt | 2006-09-05 14:58 | 2.3K | |
![[TXT]](/icons/text.gif) | tubes.txt | 2006-09-13 07:05 | 2.6K | |
![[TXT]](/icons/text.gif) | atcp_balanced_formula.txt | 2006-09-18 18:24 | 4.9K | |
![[TXT]](/icons/text.gif) | AluminumFlares.txt | 2006-09-05 14:58 | 5.1K | |
![[TXT]](/icons/text.gif) | BlackPowderGrades.txt | 2006-09-05 15:11 | 5.3K | |
![[TXT]](/icons/text.gif) | BPsubstitutes.txt | 2006-09-05 15:01 | 6.3K | |
![[ ]](/icons/layout.gif) | Ammonium Nitrate.pdf | 2006-09-05 14:58 | 6.9K | |
![[ ]](/icons/layout.gif) | Concealing PETN.pdf | 2006-09-14 02:36 | 8.3K | |
![[TXT]](/icons/text.gif) | chloratescreen.txt | 2006-09-05 14:34 | 8.8K | |
![[ ]](/icons/unknown.gif) | PETN from diluted HNO3.doc | 2006-09-12 05:01 | 10K | |
![[TXT]](/icons/text.gif) | dangersofflash.txt | 2006-09-17 22:37 | 13K | |
![[TXT]](/icons/text.gif) | sulfates.txt | 2006-09-13 08:46 | 14K | |
![[ ]](/icons/unknown.gif) | AP calculations.xls | 2006-09-05 15:33 | 16K | |
![[ ]](/icons/layout.gif) | c4.pdf | 2006-09-18 18:30 | 16K | |
![[ ]](/icons/unknown.gif) | ATF - List of Explosive Materials.mht | 2006-09-18 18:24 | 16K | |
![[TXT]](/icons/text.gif) | Combustion and Flame.txt | 2006-09-10 22:11 | 20K | |
![[ ]](/icons/unknown.gif) | Green Goddess.doc | 2006-09-13 22:35 | 20K | |
![[ ]](/icons/layout.gif) | Composite Rocket Fuels.pdf | 2006-09-11 20:21 | 22K | |
![[ ]](/icons/unknown.gif) | Tovex.doc | 2006-09-13 07:05 | 22K | |
![[ ]](/icons/unknown.gif) | Explosive Paper.doc | 2006-09-13 08:44 | 23K | |
![[ ]](/icons/unknown.gif) | Here is an archive of many different smoke bombs.doc | 2006-09-13 22:35 | 23K | |
![[ ]](/icons/layout.gif) | Urea Nitrate.pdf | 2006-09-14 12:07 | 24K | |
![[TXT]](/icons/text.gif) | scientific american july 90.txt | 2006-09-17 22:03 | 25K | |
![[TXT]](/icons/text.gif) | whistles.txt | 2006-09-17 22:01 | 27K | |
![[ ]](/icons/layout.gif) | Picric Acid Home Manufacture.pdf | 2006-09-10 20:29 | 27K | |
![[ ]](/icons/unknown.gif) | ANFOS.doc | 2006-09-13 23:45 | 32K | |
![[ ]](/icons/layout.gif) | newinsensitivehigh.pdf | 2006-09-11 20:52 | 32K | |
![[ ]](/icons/layout.gif) | Nitration of Phenols Information - metafractal.pdf | 2006-09-17 22:19 | 35K | |
![[ ]](/icons/layout.gif) | JAGUAR calc for aluminized exp.pdf | 2006-09-10 18:14 | 39K | |
![[ ]](/icons/layout.gif) | How to make Semtex.pdf | 2006-09-10 22:30 | 40K | |
![[ ]](/icons/layout.gif) | development of hafnium passivated powders2.pdf | 2006-09-16 17:07 | 42K | |
![[ ]](/icons/unknown.gif) | Pyrotechnic Chemicals.doc | 2006-09-10 18:10 | 44K | |
![[ ]](/icons/layout.gif) | Explosive Mixtures Detonating at Low Velocity.pdf | 2006-09-11 04:10 | 46K | |
![[TXT]](/icons/text.gif) | ColoredFlameProduction.txt | 2006-09-10 22:11 | 47K | |
![[ ]](/icons/layout.gif) | A New Energetic Mixed Formal Plasticizer.pdf | 2006-09-05 17:32 | 58K | |
![[ ]](/icons/unknown.gif) | Form - Application for Explosives License.DOC | 2006-09-12 21:50 | 58K | |
![[ ]](/icons/unknown.gif) | PowerLabs Lead Styphnate Synthesis.mht | 2006-09-12 05:16 | 69K | |
![[IMG]](/icons/image2.gif) | nitrohydrazines.djvu | 2006-09-17 22:14 | 69K | |
![[ ]](/icons/layout.gif) | Improvised PETN.pdf | 2006-09-11 20:59 | 79K | |
![[ ]](/icons/unknown.gif) | improvised primary explosives -Efraim_barkbit.PDF | 2006-09-11 20:22 | 80K | |
![[ ]](/icons/layout.gif) | Trace Analysis of Peroxide-Based Explosives.pdf | 2006-09-13 07:05 | 81K | |
![[ ]](/icons/unknown.gif) | PowerLabs Potassium Permanganate Hypergols.mht | 2006-09-12 21:44 | 83K | |
![[ ]](/icons/unknown.gif) | Field Expedient Methods for Explosives Preparation.doc | 2006-09-18 17:57 | 85K | |
![[IMG]](/icons/image2.gif) | dabf.djvu | 2006-09-17 23:20 | 85K | |
![[ ]](/icons/layout.gif) | Synthesis and Analysis of N,N'-Dinitrourea.pdf | 2006-09-13 08:46 | 85K | |
![[ ]](/icons/unknown.gif) | PowerLabs Sodium Peroxide Hypergols!.mht | 2006-09-13 22:26 | 86K | |
![[ ]](/icons/layout.gif) | Detonations in pipes and in the open.pdf | 2006-09-16 17:00 | 89K | |
![[ ]](/icons/layout.gif) | BDNPA.pdf | 2006-09-05 15:22 | 90K | |
![[ ]](/icons/layout.gif) | Home And Recreational Uses For High Explosives.pdf | 2006-09-11 03:30 | 93K | |
![[ ]](/icons/layout.gif) | TetramericAcetonePeroxide.pdf | 2006-09-13 11:09 | 95K | |
![[IMG]](/icons/image2.gif) | CBTN.djvu | 2006-09-05 16:29 | 100K | |
![[ ]](/icons/layout.gif) | aldehyde nitramide.pdf | 2006-09-05 15:40 | 100K | |
![[IMG]](/icons/image2.gif) | Synthesis of tetranitroadamantane J. Org. Chem 1990, 55, 4459-4461.djvu | 2006-09-13 08:46 | 114K | |
![[ ]](/icons/layout.gif) | Explosives_explained.pdf | 2006-09-18 17:57 | 116K | |
![[ ]](/icons/layout.gif) | Explosives explained.pdf | 2006-09-14 12:10 | 116K | |
![[ ]](/icons/layout.gif) | A Candidate of New Insensitive High Explosive- MTNI.pdf | 2006-09-12 09:42 | 118K | |
![[ ]](/icons/unknown.gif) | PowerLabs Silver Oxalate Synthesis.mht | 2006-09-13 23:21 | 128K | |
![[ ]](/icons/unknown.gif) | PowerLabs Lead Picrate Synthesis.mht | 2006-09-12 05:16 | 138K | |
![[ ]](/icons/layout.gif) | Explosives Hazard Divisions and Compatibility Groups.pdf | 2006-09-17 23:10 | 138K | |
![[ ]](/icons/layout.gif) | Some Metallurgical Aspects of Shaped Charge Liners by Alistair Doig (1998).pdf | 2006-09-17 22:14 | 147K | |
![[ ]](/icons/unknown.gif) | Deflagrating reactions by powerlabs.mht | 2006-09-11 22:04 | 154K | |
![[ ]](/icons/unknown.gif) | vitamin C gun powder.doc | 2006-09-17 00:47 | 156K | |
![[ ]](/icons/unknown.gif) | Various Burn Tests-byBrainfever.mht | 2006-09-17 00:47 | 158K | |
![[ ]](/icons/layout.gif) | ALENGOSVIG's HowTo upped by metafractal.pdf | 2006-09-05 15:40 | 162K | |
![[ ]](/icons/unknown.gif) | PowerLabs Nitro Starch Synthesis.mht | 2006-09-12 09:44 | 163K | |
![[ ]](/icons/unknown.gif) | PowerLabs Potassium Styphnate Synthesis.mht | 2006-09-13 23:21 | 165K | |
![[ ]](/icons/layout.gif) | Drophammer test on azides.pdf | 2006-09-18 18:48 | 169K | |
![[TXT]](/icons/text.gif) | PFP Pyrotechnic Formulas Database - most up to date before the site was taken down.htm | 2006-09-12 04:20 | 171K | |
![[ ]](/icons/layout.gif) | PETN - Upload by Dave the Rave.pdf | 2006-09-12 05:01 | 171K | |
![[ ]](/icons/layout.gif) | Nitromethane explosives.pdf | 2006-09-17 22:14 | 178K | |
![[ ]](/icons/unknown.gif) | Procedures to make explosives.doc | 2006-09-13 08:57 | 180K | |
![[ ]](/icons/unknown.gif) | PowerLabs Acetylide Explosives Synthesis.mht | 2006-09-12 02:22 | 188K | |
![[ ]](/icons/unknown.gif) | TNP Synthese-byBrainfever.mht | 2006-09-12 21:39 | 197K | |
![[ ]](/icons/layout.gif) | cp.pdf | 2006-09-17 22:51 | 198K | |
![[ ]](/icons/unknown.gif) | PowerLabs Potassium Picrate Synthesis.mht | 2006-09-12 21:46 | 205K | |
![[ ]](/icons/unknown.gif) | PowerLabs Picric Acid Production.mht | 2006-09-12 10:14 | 208K | |
![[ ]](/icons/layout.gif) | Fuel+air+explosive+canister.pdf | 2006-09-13 22:35 | 219K | |
![[ ]](/icons/unknown.gif) | Ball mill, English.mht | 2006-09-05 16:09 | 220K | |
![[ ]](/icons/unknown.gif) | Ball mill, by wouter visser.mht | 2006-09-18 18:24 | 220K | |
![[ ]](/icons/unknown.gif) | PowerLabs Mannitol Hexanitrate Synthesis.mht | 2006-09-12 05:16 | 221K | |
![[IMG]](/icons/image2.gif) | Synthesis of Tri- and Tetranitrocubane J. Am. Chem. Soc. 1993, 115, 10195-10202.djvu | 2006-09-11 23:32 | 225K | |
![[ ]](/icons/layout.gif) | How Rocket Engines Work by Brain.pdf | 2006-09-10 22:30 | 228K | |
![[ ]](/icons/layout.gif) | Elem_Math of model rocket flight.pdf | 2006-09-18 22:05 | 230K | |
![[ ]](/icons/layout.gif) | impactfirecrackers.pdf | 2006-09-11 05:34 | 240K | |
![[ ]](/icons/layout.gif) | Evaluation of Explosive Candidates for a Thermobaric Weapon.pdf | 2006-09-11 04:10 | 246K | |
![[ ]](/icons/unknown.gif) | PowerLabs Styphnic Acid Synthesis!.mht | 2006-09-12 09:48 | 250K | |
![[ ]](/icons/layout.gif) | ANNM.pdf | 2006-09-13 23:45 | 254K | |
![[ ]](/icons/layout.gif) | Impact Firecrackers - Uploaded by X-Wulf.pdf | 2006-09-11 05:34 | 268K | |
![[IMG]](/icons/image2.gif) | HHTDD.djvu | 2006-09-13 22:35 | 268K | |
![[ ]](/icons/unknown.gif) | NG Power test-byBrainfever.mht | 2006-09-13 23:38 | 276K | |
![[ ]](/icons/layout.gif) | Fuel Air Explosive Systems.pdf | 2006-09-12 21:50 | 278K | |
![[ ]](/icons/layout.gif) | A review of energetic materials synthesis.pdf | 2006-09-05 17:32 | 283K | |
![[ ]](/icons/layout.gif) | NitromethaneLiquidExplosive.pdf | 2006-09-11 20:37 | 284K | |
![[ ]](/icons/unknown.gif) | Nitrocellulose Synthese-byBrainfever.mht | 2006-09-13 07:16 | 307K | |
![[ ]](/icons/layout.gif) | Improvised Rocket Motors.pdf | 2006-09-11 00:20 | 310K | |
![[ ]](/icons/layout.gif) | conductivity of explosives.pdf | 2006-09-17 22:51 | 315K | |
![[IMG]](/icons/image2.gif) | lakrimators-smokes.djvu | 2006-09-14 16:28 | 317K | |
![[ ]](/icons/unknown.gif) | Explosive Putty-byBrainfever.mht | 2006-09-13 10:38 | 320K | |
![[ ]](/icons/unknown.gif) | Nitrocellulose synthesis by POWERLABS!.mht | 2006-09-17 22:22 | 324K | |
![[ ]](/icons/unknown.gif) | Laboratory Explosives.mht | 2006-09-14 16:35 | 330K | |
![[ ]](/icons/layout.gif) | Shaped charges Pierce Toughest Targets.pdf | 2006-09-17 22:51 | 334K | |
![[ ]](/icons/layout.gif) | Mujahideen Explosives Handbook.pdf | 2006-09-11 01:30 | 349K | |
![[ ]](/icons/unknown.gif) | Explosives and Explosions Revised.ppt | 2006-09-14 12:08 | 355K | |
![[ ]](/icons/layout.gif) | 662.220 Explosive Dusts by Lecker.pdf | 2006-09-10 15:40 | 369K | |
![[ ]](/icons/unknown.gif) | Nitroglycerine Synthese1-byBrainfever.mht | 2006-09-17 23:11 | 401K | |
![[ ]](/icons/layout.gif) | Detection of Nitroaromatic Explosives.pdf | 2006-09-14 12:09 | 406K | |
![[ ]](/icons/layout.gif) | Detection of Explosives by Electronic Noses.pdf | 2006-09-12 01:17 | 409K | |
![[ ]](/icons/layout.gif) | NTO-Based Explosive Formulations A Technology Review.pdf | 2006-09-17 22:57 | 446K | |
![[ ]](/icons/layout.gif) | Rack-A-Rock -By Madog.pdf | 2006-09-12 10:13 | 449K | |
![[ ]](/icons/layout.gif) | Crystallization and Characterization of RDX HMX and CL-20.pdf | 2006-09-17 23:20 | 456K | |
![[ ]](/icons/layout.gif) | NTAR 1.pdf | 2006-09-17 22:57 | 465K | |
![[ ]](/icons/layout.gif) | Uncle Festers Home Workshop Explosives - upped by blindreeper.pdf | 2006-09-14 12:08 | 500K | |
![[ ]](/icons/unknown.gif) | PowerLabs Fulminates Synthesis.mht | 2006-09-12 01:26 | 508K | |
![[ ]](/icons/unknown.gif) | Detonator-byBrainfever.mht | 2006-09-16 17:12 | 516K | |
![[ ]](/icons/unknown.gif) | Rocket test-byBrainfever.mht | 2006-09-17 21:58 | 523K | |
![[ ]](/icons/layout.gif) | Car Bomb Recognition Guide.pdf | 2006-09-18 18:30 | 527K | |
![[ ]](/icons/layout.gif) | ImplosionFAE.pdf | 2006-09-12 01:44 | 542K | |
![[ ]](/icons/layout.gif) | Chemical and Ballistic Properties of Black Powder.pdf | 2006-09-14 12:09 | 569K | |
![[ ]](/icons/layout.gif) | Selectable Initiation Shaped charges.pdf | 2006-09-17 22:03 | 585K | |
![[ ]](/icons/layout.gif) | Small-Scale Safety and Performance Characterization of New P.pdf | 2006-09-17 22:22 | 604K | |
![[ ]](/icons/layout.gif) | First-Principles Study of HE Decomp Energetics.pdf | 2006-09-12 06:29 | 625K | |
![[ ]](/icons/unknown.gif) | String Dynamite-byBrainfever.mht | 2006-09-17 22:14 | 629K | |
![[ ]](/icons/layout.gif) | (MTV-2) Preparation of Magnesium-Fluoropolymer Pyrotechnic M.pdf | 2006-09-05 17:30 | 639K | |
![[ ]](/icons/layout.gif) | Improvised Cap Sensitive Mixtures from Ammonium Nitrate - upped by Xyz.pdf | 2006-09-11 20:59 | 651K | |
![[ ]](/icons/layout.gif) | Bottle rocket handbook.pdf | 2006-09-05 16:12 | 670K | |
![[IMG]](/icons/image2.gif) | Kamlet.djvu | 2006-09-17 21:59 | 681K | |
![[ ]](/icons/layout.gif) | The Ignition of Explosives by Radiation by J Eggert (1958).pdf | 2006-09-11 20:27 | 727K | |
![[ ]](/icons/unknown.gif) | Polumna Experiments-byBrainfever.mht | 2006-09-12 05:14 | 784K | |
![[ ]](/icons/layout.gif) | (LOVEX) Low-vulnerability explosives for mass-use warheads.pdf | 2006-09-05 17:38 | 790K | |
![[ ]](/icons/layout.gif) | A small-scale Screening Test for HE Performance Application .pdf | 2006-09-05 17:34 | 815K | |
![[ ]](/icons/layout.gif) | CHAPTER 11-the preparation of nitrobenzenes.pdf | 2006-09-05 17:25 | 821K | |
![[ ]](/icons/layout.gif) | (LOVEX) Paste extrudable explosives- history and current sta.pdf | 2006-09-05 17:31 | 856K | |
![[ ]](/icons/layout.gif) | ira-explosives.pdf | 2006-09-10 21:41 | 879K | |
![[ ]](/icons/layout.gif) | nuclear weapons effects.pdf | 2006-09-12 00:20 | 950K | |
![[ ]](/icons/layout.gif) | DDNP - A detonating explosive.pdf | 2006-09-17 22:37 | 1.0M | |
![[ ]](/icons/unknown.gif) | NigerianAmmoDump by JC.pps | 2006-09-17 23:28 | 1.0M | |
![[ ]](/icons/layout.gif) | The Complete Book of Flash Powder upped by wrench352.pdf | 2006-09-14 12:10 | 1.0M | |
![[ ]](/icons/unknown.gif) | EXPLOSIVES SCIENCE.mht | 2006-09-18 17:57 | 1.0M | |
![[ ]](/icons/layout.gif) | Improvised Shaped Charges.pdf | 2006-09-12 04:52 | 1.0M | |
![[ ]](/icons/layout.gif) | cia field expediant methods for explosives preparations.pdf | 2006-09-05 14:58 | 1.0M | |
![[ ]](/icons/layout.gif) | SAND98-1191.pdf | 2006-09-17 22:03 | 1.1M | |
![[ ]](/icons/layout.gif) | Combustion Mechanism of New Polymer-Oxidizer Mixtures (Prope.pdf | 2006-09-11 20:21 | 1.2M | |
![[ ]](/icons/layout.gif) | model rocket tech report 1.pdf | 2006-09-13 08:58 | 1.2M | |
![[ ]](/icons/layout.gif) | The Blasters Training Manual -uploaded by efraim_barkbit.pdf | 2006-09-14 12:10 | 1.3M | |
![[ ]](/icons/layout.gif) | (LOVEX) The search for high energy low vulnerability explosi.pdf | 2006-09-05 17:36 | 1.3M | |
![[ ]](/icons/layout.gif) | A-Files.pdf | 2006-09-05 17:35 | 1.4M | |
![[ ]](/icons/layout.gif) | Two Component High Explosive Mixtures (Desert Publications).pdf | 2006-09-14 12:08 | 1.4M | |
![[ ]](/icons/unknown.gif) | Silver Acetylide Synthesis-byBrainfever.mht | 2006-09-17 23:00 | 1.5M | |
![[ ]](/icons/layout.gif) | Warheads[BY BUZZY].pdf | 2006-09-12 05:35 | 1.5M | |
![[ ]](/icons/layout.gif) | CIA Remote Detonation.pdf | 2006-09-13 23:55 | 1.5M | |
![[ ]](/icons/layout.gif) | Chemistry of Pyrotechnics-basic principles and theory by John A. Conkling (1985).pdf | 2006-09-05 14:39 | 1.6M | |
![[ ]](/icons/layout.gif) | Non-Traditional Explosives Potential Detection Problems by Oxley.pdf | 2006-09-17 22:29 | 1.6M | |
![[ ]](/icons/layout.gif) | US Army Ammunition and Explosives Safety Standards.pdf | 2006-09-17 00:47 | 1.8M | |
![[ ]](/icons/layout.gif) | (MTV-1) Magnesium-Teflon-Viton Pyrotechnic Compositions.pdf | 2006-09-05 17:38 | 1.8M | |
![[ ]](/icons/layout.gif) | Recovery of Energetic Components from Propellant.pdf | 2006-09-17 09:27 | 1.8M | |
![[ ]](/icons/layout.gif) | Ordnance and Explosives Response - metafractal.pdf | 2006-09-12 00:24 | 1.9M | |
![[ ]](/icons/unknown.gif) | Potassium Nitrate-byBrainfever.mht | 2006-09-12 04:24 | 1.9M | |
![[ ]](/icons/layout.gif) | KIPE, KIPE2, KIBC and KIFE in one - upped by blindreeper.pdf | 2006-09-17 23:28 | 1.9M | |
![[ ]](/icons/layout.gif) | TM 9 1300 214 Military Explosives - Upload by Dave the Rave.pdf | 2006-09-12 05:02 | 1.9M | |
![[ ]](/icons/layout.gif) | New Energetic Materials.pdf | 2006-09-12 01:57 | 1.9M | |
![[ ]](/icons/layout.gif) | Explosives and Propellants from Commonly Available Materials.pdf | 2006-09-14 12:10 | 2.0M | |
![[ ]](/icons/layout.gif) | model rockety.pdf | 2006-09-12 01:33 | 2.0M | |
![[ ]](/icons/layout.gif) | Ammunition and Explosives Safety Standards.pdf | 2006-09-14 02:29 | 2.2M | |
![[ ]](/icons/layout.gif) | model rocket tech report 3.pdf | 2006-09-13 09:09 | 2.3M | |
![[ ]](/icons/layout.gif) | Propellants and Explosives - Thermochemical Aspects of Combustion.pdf | 2006-09-13 08:57 | 2.3M | |
![[ ]](/icons/unknown.gif) | Explosives 5th ed by K”hler, Meyer, and Homburg (2002).pd | 2006-09-13 07:28 | 2.4M | |
![[ ]](/icons/layout.gif) | Preperation of Erythritol Tetranitrate.pdf | 2006-09-13 07:53 | 2.5M | |
![[ ]](/icons/layout.gif) | model rocket tech report 4.pdf | 2006-09-12 04:23 | 2.5M | |
![[ ]](/icons/layout.gif) | Sensitivity and Performance Characterization of Ammonium Dinitramide (ADN).pdf | 2006-09-12 05:24 | 2.6M | |
![[ ]](/icons/layout.gif) | Elsevier - Advanced Control Engineering - 2001.pdf | 2006-09-17 00:47 | 2.6M | |
![[ ]](/icons/layout.gif) | Energetic Materials - Inorganic Azides (OCRed).pdf | 2006-09-13 22:26 | 2.6M | |
![[ ]](/icons/layout.gif) | Kitchen Improvised Fertilizer Explosives.pdf | 2006-09-17 23:28 | 2.8M | |
![[ ]](/icons/layout.gif) | 662.2 High Explosives and Propellants by Fordham.pdf | 2006-09-05 17:38 | 2.8M | |
![[ ]](/icons/unknown.gif) | Nitroglycerine Synthese b-byBrainferver.mht | 2006-09-17 23:21 | 2.8M | |
![[ ]](/icons/layout.gif) | 531.5507821 Backyard Ballistics by Gurstelle.pdf | 2006-09-05 17:33 | 3.2M | |
![[ ]](/icons/layout.gif) | CIA Improvised Sabotage Devices.pdf | 2006-09-14 00:01 | 3.3M | |
![[ ]](/icons/layout.gif) | Blackbook Companion published by Paladin Press (1995).pdf | 2006-09-05 17:37 | 3.3M | |
![[ ]](/icons/layout.gif) | FMX The Revised Black Book A Guide To Field-Manufactured Explosives by Wallace.pdf | 2006-09-12 21:50 | 3.4M | |
![[ ]](/icons/layout.gif) | A guide to field manufactured explosives.pdf | 2006-09-05 17:38 | 3.4M | |
![[ ]](/icons/layout.gif) | Pyrotechny1829 - VERY old pyro book - upped by Xyz.pdf | 2006-09-12 09:56 | 3.5M | |
![[ ]](/icons/layout.gif) | model rocket tech report 2.pdf | 2006-09-13 11:14 | 3.8M | |
![[ ]](/icons/layout.gif) | Anarchist Cookbook V2000.pdf | 2006-09-14 02:29 | 3.8M | |
![[ ]](/icons/unknown.gif) | sugar-rocket.doc | 2006-09-14 16:15 | 3.8M | |
![[ ]](/icons/layout.gif) | Whistles - Pyrotechnica XI.pdf | 2006-09-17 22:01 | 4.1M | |
![[ ]](/icons/layout.gif) | 793.820 Magician's Arsenal Professional Tricks of the Trade by Lee Scott (1993).pdf | 2006-09-11 22:39 | 4.9M | |
![[ ]](/icons/layout.gif) | Chemistry and Technology of Explosives vol 1 by Urbanski.pdf | 2006-09-13 09:50 | 5.1M | |
![[ ]](/icons/layout.gif) | Detonation Chemistry, An Investigation Of Fluorine As An Oxi.pdf | 2006-09-16 17:00 | 5.2M | |
![[ ]](/icons/layout.gif) | The Advanced Anarchist Arsenal by David Harber - Jelly.pdf | 2006-09-13 11:34 | 5.3M | |
![[ ]](/icons/layout.gif) | ragnars_homemade_detonators.pdf | 2006-09-12 10:13 | 5.4M | |
![[ ]](/icons/layout.gif) | Leroy_Rocket_Book.pdf | 2006-09-13 08:14 | 6.1M | |
![[ ]](/icons/layout.gif) | Solid Propellant Grain Design and Internal Ballistics by NASA 1972.pdf | 2006-09-12 02:36 | 6.5M | |
![[ ]](/icons/layout.gif) | Explosive Principles by Robert Sickler.pdf | 2006-09-13 11:13 | 7.8M | |
![[ ]](/icons/layout.gif) | IMPROVISED.MUNITIONS.BLACK.BOOK-Vol1-1981(notOCR).pdf | 2006-09-12 06:13 | 9.7M | |
![[ ]](/icons/layout.gif) | ng.pdf | 2006-09-17 23:11 | 10M | |
![[ ]](/icons/layout.gif) | A Multiple Capability Sympathetic Detonator System for the U.S. Special Forces.pdf | 2006-09-05 17:38 | 11M | |
![[ ]](/icons/layout.gif) | Chemistry of Powder and Explosives by Tenny L Davis.pdf | 2006-09-14 12:08 | 12M | |
![[ ]](/icons/layout.gif) | 662.2 The Chemistry of Explosives by Jacqueline Akhavan (1998).pdf | 2006-09-10 18:26 | 12M | |
![[ ]](/icons/layout.gif) | The Anarchist Arsenal by David Harber - Jelly.pdf | 2006-09-14 12:09 | 13M | |
![[ ]](/icons/layout.gif) | Nitro Explosives a Practical Treatise by Sanford (1906).pdf | 2006-09-17 22:19 | 17M | |
![[ ]](/icons/unknown.gif) | ARSON_ELECTRICAL_TIMERS.PDF | 2006-09-18 18:24 | 17M | |
![[ ]](/icons/layout.gif) | [Explosives.and.Weapons] Homeworkshop Firearms Vol2 - The Handgun.pdf | 2006-09-12 09:42 | 19M | |
![[ ]](/icons/layout.gif) | -chief24 2nd try- Herbet Ellern - Military And Civilian Pyrotechnics.pdf | 2006-09-05 17:38 | 20M | |
![[ ]](/icons/layout.gif) | New and Improved C-4 by Benson.pdf | 2006-09-12 06:36 | 21M | |
![[ ]](/icons/layout.gif) | Elsevier - Valve Selection Handbook, 5th Ed - 2004 - (By Laxxuss).pdf | 2006-09-17 00:47 | 22M | |
![[ ]](/icons/layout.gif) | Chemistry - Chemical Engineering (McGraw Hill;1996;606 pg) Essentials of Process Control (Dupont).pdf | 2006-09-14 12:09 | 25M | |
![[ ]](/icons/layout.gif) | Chemistry and Technology of Explosives vol 2 by Urbanski.pdf | 2006-09-05 17:38 | 26M | |
![[ ]](/icons/layout.gif) | Chemistry and Technology of Explosives vol 3 by Urbanski.pdf | 2006-09-05 17:38 | 37M | |
![[ ]](/icons/layout.gif) | e,p&p(xoo1246).pdf | 2006-09-18 22:05 | 46M | |
![[ ]](/icons/layout.gif) | BRASSEY'S WORLD MILTARY TECHNOLOGY - Explosives, Propellants And Pyrotechnics - metafractal.pdf | 2006-09-18 18:30 | 46M | |
![[ ]](/icons/layout.gif) | Chemistry and Technology of Explosives vol 4 by Urbanski.pdf | 2006-09-14 12:13 | 53M | |
![[ ]](/icons/layout.gif) | TM31-210-Improvised Munitions Handbook.pdf | 2006-09-12 07:05 | 81M | |
|