![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Carbon Dioxide Sensing Fundamentals, Principles, and Applications.pdf | 2019-08-02 03:22 | 15M | |
| Castable Polyurethane Elastomers, 2nd edition.pdf | 2019-08-02 03:01 | 5.4M | |
| Chemistry & Chemical Reactivity.pdf | 2019-08-02 03:22 | 192M | |
| Chemistry - A Molecular Approach, 4th Edition.pdf | 2019-08-02 03:22 | 178M | |
| Combustion - Types of Reactions, Fundamental Processes and Advanced Technologies.pdf | 2019-08-02 03:22 | 6.8M | |
| Condensed-Phase Molecular Spectroscopy and Photophysics.pdf | 2019-08-02 03:22 | 7.1M | |
![[DIR]](/icons/folder.gif) | Covers/ | 2019-08-18 18:33 | - | |
| Enantioselection in Asymmetric Catalysis.pdf | 2019-08-02 03:22 | 3.6M | |
| Encyclopedia of Biocolloid and Biointerface Science, 2 Volume Set.pdf | 2019-08-02 03:22 | 111M | |
| Encyclopedia of Nanotechnology.pdf | 2019-08-02 03:22 | 278M | |
| Fundamentals of Analytical Chemistry, 9th edition.pdf | 2019-08-02 03:22 | 92M | |
| General chemistry - principles and modern applications, 11th Edition.pdf | 2019-08-02 03:22 | 141M | |
| Handbook of Relativistic Quantum Chemistry.pdf | 2019-08-02 03:22 | 8.4M | |
| High Temperature Experiments in Chemistry and Materials Science.pdf | 2019-08-02 02:28 | 5.1M | |
| Introduction to Reticular Chemistry Metal-Organic Frameworks and Covalent Organic Frameworks.pdf | 2019-08-02 03:22 | 30M | |
| Lewis Base Catalysis in Organic Synthesis, 3 Volume Set.pdf | 2019-08-02 03:22 | 97M | |
| Molybdenum and Tungsten Enzymes - Biochemistry.pdf | 2019-08-02 03:22 | 24M | |
| Organic Chemistry, 6th Edition By Marc Loudon.pdf | 2019-08-02 03:22 | 106M | |
| Organic Chemistry, Student Study Guide and Solutions Manual.pdf | 2019-08-02 03:22 | 54M | |
| Organic Chemistry By David Klein.pdf | 2019-08-02 03:22 | 341M | |
| Side Reactions in Organic Synthesis II - Aromatic Substitutions.pdf | 2019-08-02 03:22 | 2.1M | |
|
|---|