![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | vet/ | 2021-02-15 10:10 | - | |
| med/ | 2021-01-10 21:22 | - | |
![[ ]](/icons/unknown.gif) | kistner's gynecology and women's health.pdb | 2006-06-08 21:04 | 1.5M | |
| Yanoff ophthalmology 1ed.pdb | 2006-06-09 00:17 | 3.0M | |
| Yanoff - Ophthalmology 2nd ed.pdb | 2006-06-09 04:30 | 305M | |
| Yamada's Textbook of Gastroenterology 4th Ed.pdb | 2006-06-09 04:21 | 48M | |
| Wolfson - The Clinical Practice of Emergency Medicine 3rd ed.pdb | 2006-06-09 03:29 | 27M | |
| Wintrobe's Clinical Hematology 11th.pdb | 2006-06-09 04:35 | 29M | |
| Wintrobe’s Clinical Hematology 10ed with images.pdb | 2006-06-09 03:40 | 41M | |
| Wilmore - ACS Surgery - Principles and Practice 2nd ed.pdb | 2006-06-09 04:34 | 170M | |
| Wills eye manual 3ed.pdb | 2006-06-02 20:36 | 653K | |
| Williams Textbook of Endocrinology10th ed.pdb | 2006-06-09 00:21 | 6.5M | |
| Williams Obstetrics 21st Ed With Images.pdb | 2006-06-09 03:58 | 41M | |
| Williams Endocrinology 10ed(all imgs).pdb | 2006-06-09 04:08 | 22M | |
| What to order when 2ed.pdb | 2006-06-02 06:16 | 276K | |
| Weinstein - Plumer's Principles & Practice of Intravenous Th.pdb | 2006-06-08 19:53 | 6.1M | |
| Webb - Oxford Textbook of Critical Care.pdb | 2006-06-09 02:04 | 18M | |
| Washington Manual of Surgery 2002.pdb | 2006-06-08 20:25 | 2.3M | |
| Washington Manual of Diagnosis and Therapy 30ed.pdb | 2006-06-09 01:57 | 1.1M | |
| Warrell - Oxford Textbook of Medicine 4th ed.pdb | 2006-06-09 04:39 | 88M | |
| Walsh - Campbell's Urology 8th ed .pdb | 2006-06-09 03:31 | 10M | |
| Walls - Manual of Emergency Airway Management.pdb | 2006-06-08 21:18 | 1.4M | |
| Wallach - Interpretation of Diagnostic Tests 7th ed.pdb | 2006-06-09 01:13 | 5.8M | |
| Wagner - Marriott's Practical Electrocardiography 10th ed.pdb | 2006-06-09 02:59 | 12M | |
| Wachter - Hospital Medicine.pdb | 2006-06-09 02:28 | 13M | |
| Victor - Adams & Victor's Principles Of Neurology 7th ed.pdb | 2006-06-09 04:40 | 13M | |
| University of Iowa Family Practice Handbook 4ed.pdb | 2006-06-09 03:28 | 2.3M | |
| Topol - Textbook of Cardiovascular Medicine 2002.pdb | 2006-06-09 04:40 | 172M | |
| Tintinalli - Emergency Medicine A Comprehensive Study Guide .pdb | 2006-06-09 01:54 | 43M | |
| The_Surgical_Intern_Pocket_Surv.PDB | 2006-06-28 21:44 | 100K | |
| The Review of Natural Products 2004.pdb | 2006-06-08 01:21 | 2.2M | |
| The Johns Hopkins Manual of Gynecology and Obstetrics 2nd ed.pdb | 2006-06-09 00:03 | 3.9M | |
| The ICU Book 2nd Ed.pdb | 2006-06-02 19:04 | 927K | |
![[ ]](/icons/layout.gif) | The Encyclopedia of Essential Oils.pdf | 2020-06-07 11:55 | 1.7M | |
| Taylor - Manual of Family Practice 2nd ed.pdb | 2006-06-09 03:36 | 3.0M | |
| Sweet - Infectious Diseases of the Female Genital Tract 4ed.pdb | 2006-06-09 03:23 | 11M | |
| Stenchever - Comprehensive Gynecology 4th ed.pdb | 2006-06-09 04:40 | 113M | |
| Springer.-.Pediatric.Cataract.Surgery.And.IOL.Implantation.A.Case-Based.Guide.2020/ | 2021-01-10 21:25 | - | |
| Speroff - Clinical Gynecologic Endocrinology and Infertility.pdb | 2006-06-09 02:00 | 7.8M | |
| Speer - Pediatric Care Planning 3rd ed.pdb | 2006-06-05 16:57 | 601K | |
| Souhami - Oxford Textbook of Oncology.pdb | 2006-06-09 04:21 | 52M | |
| Skyscape apps/ | 2021-01-10 21:22 | - | |
| Siroky - Manual of Urology Diagnosis and Therapy 2nd ed.pdb | 2006-06-09 03:44 | 4.0M | |
| Singleton - Primary Care 1st ed.pdb | 2006-06-09 00:59 | 13M | |
| Shils - Modern Nutrition in Health and Disease 9th ed.pdb | 2006-06-09 04:36 | 25M | |
| Schwartz Principles of Surgery 7ed.pdb | 2006-06-08 13:22 | 3.5M | |
| Schwartz - Principles of Surgery, Companion Handbook 7th ed.pdb | 2006-06-08 15:10 | 3.3M | |
| Schwartz - Principles and Practice of Emergency Medicine 4th.pdb | 2006-06-09 04:40 | 48M | |
| Schrier - Manual of Nephrology Diagnosis and Therapy 5th ed.pdb | 2006-06-08 15:55 | 3.2M | |
| Schrier - Diseases of the Kidney and Urinary Tract_ 7th ed.pdb | 2006-06-09 04:00 | 53M | |
| Samuels - Manual of Neurologic Therapeutics 6th ed.pdb | 2006-06-08 21:06 | 1.8M | |
| Sabiston Textbook of Surgery, 16th Edition.pdb | 2006-06-09 03:21 | 7.0M | |
| Ruddy - Kelley's Textbook of Rheumatology 6th Ed.pdb | 2006-06-09 04:40 | 198M | |
| Rubin Ovarian Cancer 2ed.pdb | 2006-06-08 13:50 | 6.6M | |
| Rosenberg - Cancer - Principles and Practice of Oncology 6th.pdb | 2006-06-09 03:29 | 59M | |
| Rockwood Fractures in children 5ed.pdb | 2006-06-09 04:28 | 36M | |
| Rockwood Fractures in Adults 5ed.pdb | 2006-06-09 04:33 | 59M | |
| Roberts and Hedges Emergency Medicine Procedures.PDB | 2006-06-09 01:01 | 2.3M | |
| Roberts - Manual of Clinical Problems in Pediatrics 5th ed.pdb | 2006-06-02 12:20 | 1.0M | |
| Roberts & Hedges - Clinical Procedures in Emergency Medicine.pdb | 2006-06-09 04:40 | 213M | |
| Robbins Pathologic Basis of Disease, 6th Edition.pdb | 2006-06-08 12:51 | 4.0M | |
| Rhee - The Wills Eye Manual Office and Emergency Room Diagno.pdb | 2006-06-08 15:35 | 1.0M | |
| Raymond - Pediatric Primary Care Well-Child Care.pdb | 2006-06-08 17:09 | 2.4M | |
| Raymond - Pediatric Primary Care Ill-Child Care.pdb | 2006-06-08 19:57 | 2.3M | |
| Ravel - Clinical Laboratory Medicine - Clinical Applications.pdb | 2006-06-08 23:23 | 3.5M | |
| Rakel - Textbook of Family Practice 6th ed.pdb | 2006-06-09 04:31 | 57M | |
| Rakel - Integrative Medicine 2002.pdb | 2006-06-08 19:18 | 8.7M | |
| Programas/ | 2021-03-31 13:02 | - | |
| Pizzorno - Textbook of Natural Medicine 2nd ed.pdb | 2006-06-09 03:15 | 8.7M | |
| Pizzo - Principles and Practice of Pediatric Oncology 4th Ed.pdb | 2006-06-09 01:03 | 23M | |
| Perry - The Chemotherapy Source Book 3rd ed.pdb | 2006-06-08 17:27 | 10M | |
| Peitzman - The Trauma Manual 2nd ed.pdb | 2006-06-08 16:01 | 5.0M | |
| Pediatric Surgical Handbook.pdb | 2006-06-02 14:12 | 210K | |
| Pavan-Langston - Manual of Ocular Diagnosis and Therapy 5th .pdb | 2006-06-09 00:07 | 2.8M | |
| Paul - Fundamental Immunology 5th ed.pdb | 2006-06-09 01:44 | 13M | |
| Patterson's Allergic Diseases 6th ed.pdb | 2006-06-08 23:42 | 8.7M | |
| Park - Pediatric Cardiology for Practitioners 4th ed.pdb | 2006-06-09 00:53 | 27M | |
| Paget - Manual of Rheumatology and Outpatient Orthopedic Dis.pdb | 2006-06-09 02:35 | 2.5M | |
| Oski's Pediatrics - Principles and Practice 3rd Ed.pdb | 2006-06-09 04:40 | 51M | |
| Novak's Gynecology 13ed.pdb | 2006-06-09 01:38 | 17M | |
| Noble - Textbook of Primary Care Medicine 3rd ed.pdb | 2006-06-09 04:20 | 168M | |
| Nelson Textbook of Pediatrics 16ed.pdb | 2006-06-08 12:33 | 10M | |
| Neinstein - Adolescent Health Care - A Practical Guide.pdb | 2006-06-09 02:22 | 11M | |
| Natural Standard 2004.pdb | 2006-06-08 22:11 | 3.2M | |
| Morris - Oxford Textbook of Surgery 2nd ed.pdb | 2006-06-09 04:40 | 101M | |
| Miller Anesthesia, 5th ed.pdb | 2006-06-08 18:26 | 7.8M | |
| Middleton - Allergy principles and practice 5th ed.pdb | 2006-06-09 03:40 | 18M | |
| Metheny - Fluid and Electrolyte Balance 4th Ed.pdb | 2006-06-08 19:12 | 2.8M | |
| Merritt - Merritt's Neurology 10th Ed.pdb | 2006-06-09 03:20 | 19M | |
| Merck Manual -17th Ed..pdb | 2006-06-08 14:48 | 1.4M | |
| Merck Geriatrics, 3rd Ed.pdb | 2006-06-05 15:36 | 1.5M | |
| Menkes - Child Neurology 6th ed.pdb | 2006-06-09 02:56 | 14M | |
| Mega pack of Sex ebooks/ | 2021-01-10 21:22 | - | |
| Medical Management of HIV Infection.pdb | 2006-06-09 04:40 | 777K | |
| McEvoy - AHFS Drug Information 2004.pdb | 2006-06-08 23:06 | 32M | |
| McCann - Diseases 3rd Ed.pdb | 2006-06-09 03:56 | 14M | |
| McAninch - Smith's General Urology 6th Ed.pdb | 2006-06-09 03:40 | 23M | |
| Marx - Rosen's Emergency Medicine - Concepts and Clinical Pr.pdb | 2006-06-09 03:15 | 159M | |
| Marriots Practical ECG 10th ed.pdb | 2006-06-08 16:06 | 2.6M | |
| Manual of Clinical Oncology.pdb | 2006-06-09 00:51 | 1.9M | |
| Mandell - Mandell Douglas and Bennett's Principles & Practic.pdb | 2006-06-09 03:49 | 55M | |
| Lovell - Lovell and Winter's Pediatric Orthopaedics 3rd ed.pdb | 2006-06-09 04:34 | 35M | |
| Lord - Family-Focused Behavioral Pediatrics 1st ed.pdb | 2006-06-08 18:59 | 1.7M | |
| Long - Principles and Practice of Pediatric Infectious Disea.pdb | 2006-06-09 03:09 | 25M | |
| Loeser - Bonica's Management of Pain 3rd ed.pdb | 2006-06-09 03:10 | 37M | |
| Lewis - Child and Adolescent Psychiatry - A Comprehensive Te.pdb | 2006-06-09 02:24 | 12M | |
| Ledingham - Concise Oxford Textbook of Medicine 2000.pdb | 2006-06-09 04:20 | 52M | |
| Koopman - Arthritis and Allied Conditions A Textbook of Rheu.pdb | 2006-06-09 02:27 | 41M | |
| Klaassen - Casarett & Doull's Toxicology The Basic Science o.pdb | 2006-06-09 04:30 | 14M | |
| Kaplan Textbook of Psychiatry with images 7ed.pdb | 2006-06-09 03:45 | 51M | |
| Kaplan - Kaplan's Clinical Hypertension 8th ed .pdb | 2006-06-08 22:55 | 6.1M | |
| Kantoff - Prostate Cancer Principles and Practice 1st ed.pdb | 2006-06-08 19:25 | 8.4M | |
| Juhl - Paul and Juhl's Essentials of Radiologic Imaging 7th .pdb | 2006-06-09 04:31 | 64M | |
| Josephson - Clinical Cardiac Electrophysiology Techniques an.pdb | 2006-06-09 02:55 | 27M | |
| Jonas - Essentials of Complementary and Alternative Medicine.pdb | 2006-06-09 02:55 | 3.0M | |
| Janicak - Principles and Practice of Psychopharmacotherapy 3.pdb | 2006-06-09 01:45 | 5.2M | |
| James - Field Guide to Urgent and Ambulatory Care Procedures.pdb | 2006-06-08 22:54 | 2.9M | |
| Jacobson - Psychiatric Secrets (The Secrets Series) 2nd ed.pdb | 2006-06-08 20:46 | 1.2M | |
| Isenberg - Oxford textbook of rheumatology 2nd ed.pdb | 2006-06-09 02:53 | 46M | |
| Irwin and Rippe's Intensive Care Medicine 5th ed.pdb | 2006-06-09 03:24 | 24M | |
| Hurst's The Heart 10th ed.pdb | 2006-06-09 04:14 | 57M | |
| Hurford - Clinical Anesthesia Procedures of the Massachusett.pdb | 2006-06-09 04:40 | 2.8M | |
| Humes - Kelley's Textbook of Internal Medicine 4th ed.pdb | 2006-06-09 04:40 | 52M | |
| How Sex Works Why We Look, Smell, Taste, Feel, and Act the Way We Do-Mantesh/ | 2021-01-10 21:22 | - | |
| Hopkins Abxguide/ | 2021-01-10 21:22 | - | |
| Holland-Frei Cancer Medicine 6th edition.pdb | 2006-06-09 03:12 | 67M | |
| Hoffman - Hematology- Basic Principles and Practice 3rd ed.pdb | 2006-06-09 03:44 | 9.9M | |
| Havens - Manual of Outpatient Gynecology 4ed.pdb | 2006-06-08 19:48 | 2.0M | |
| Harvey - Lung Cancer Principles and Practice 2nd ed.pdb | 2006-06-09 02:52 | 18M | |
| Harrison 15Ed.pdb | 2006-06-08 06:27 | 7.4M | |
| Harris - Diseases of the Breast 2nd ed.pdb | 2006-06-09 01:54 | 15M | |
| Hall - Sauer's Manual of Skin Diseases 8th ed.pdb | 2006-06-09 01:54 | 12M | |
| Habif Clinical Dermatology 3rd.pdb | 2006-06-09 03:12 | 2.1M | |
| Habif - Clinical Dermatology - A Color Guide to Diagnosis and Therapy 4th ed.pdb | 2006-06-09 04:27 | 204M | |
| Grossman's Cardiac Catheterization, Angiography, and Interve.pdb | 2006-06-09 04:19 | 16M | |
| Greenfield - Essentials of Surgery - Scientific Principles a.pdb | 2006-06-09 03:56 | 53M | |
| Greene - AJCC Cancer Staging Handbook 6th Edition 2002.pdb | 2006-06-08 22:46 | 3.2M | |
| Greenberg - Clinical Neurology 5th ed.pdb | 2006-06-09 03:19 | 5.7M | |
| Green-Hernandez - Primary Care Pediatrics 1st ed.pdb | 2006-06-08 17:19 | 8.2M | |
| Green - Child and Adolescent Clinical Psychopharmacology 3rd.pdb | 2006-06-02 20:11 | 785K | |
| Grays Anatomy-16g.pdb | 2006-06-09 00:18 | 6.4M | |
| Grant's Dissector/ | 2021-01-11 17:35 | - | |
| Grainger - Grainger & Allison's Diagnostic Radiology - A Tex.pdb | 2006-06-09 04:40 | 285M | |
| Govindan - The Washington Manual of Oncology.pdb | 2006-06-08 09:14 | 3.7M | |
| Goroll - Primary Care Medicine Recommendations 1st ed.pdb | 2006-06-02 21:25 | 837K | |
| Goroll - Primary Care Medicine Office Evaluation and Managem.pdb | 2006-06-09 04:34 | 9.5M | |
| Goetz textbook of neurology.pdb | 2006-06-08 13:00 | 3.1M | |
| Glenn's Urologic Surgery 5th ed.pdb | 2006-06-09 02:54 | 24M | |
| Gitlow - Substance Use Disorders A Practical Guide 1st ed.pdb | 2006-06-02 13:40 | 322K | |
| Gillenwater - Adult and Pediatric Urology 4th ed.pdb | 2006-06-09 02:56 | 65M | |
| Gelder - New Oxford Textbook of Psychiatry 2003.pdb | 2006-06-09 03:09 | 16M | |
| Gantz - Manual of Clinical Problems in Infectious Disease 4t.pdb | 2006-06-09 03:27 | 2.1M | |
| Gallo - Reichel's Care of the Elderly Clinical Aspects of Ag.pdb | 2006-06-08 15:09 | 5.1M | |
| Gabbe - Obstetrics - Normal and Problem Pregnancies 4th ed 2.pdb | 2006-06-08 14:40 | 6.0M | |
| Fu - Sports Injuries Mechanisms Prevention Treatment 2nd ed.pdb | 2006-06-09 03:11 | 28M | |
| Frontera - Essentials of Physical Medicine and Rehabilitatio.pdb | 2006-06-09 02:11 | 30M | |
| Frizzell - Handbook of Pathophysiology.pdb | 2006-06-09 03:40 | 6.9M | |
| Fleisher - Textbook of Pediatric Emergency Medicine 4th ed.pdb | 2006-06-09 01:36 | 38M | |
| Fitzpatrick's Dermatology In General Medicine 6th ed.pdb | 2006-06-09 01:23 | 67M | |
| Fischer - Lippincott_s Cancer Chemotherapy Handbook 2nd Ed.pdb | 2006-06-08 09:48 | 2.5M | |
| Fischbach - A Manual of Laboratory and Diagnostic Tests 7th .pdb | 2006-06-08 20:56 | 3.2M | |
| Fields - Virology 4th Ed.pdb | 2006-06-09 03:22 | 35M | |
| Fetology - Diagnosis and Management of the Fetal Patient 1st.pdb | 2006-06-09 00:07 | 22M | |
| Ferri - Practical Guide to the Care of the Medical Patient 5.pdb | 2006-06-08 21:41 | 10M | |
| Ferri - Ferri's Clinical Advisor 2004 - Instant Diagnosis and Treatment 6th ed.pdb | 2006-06-09 04:31 | 85M | |
| Feliciano - Trauma - 5th Ed.pdb | 2006-06-09 04:07 | 31M | |
| Feldman - Sleisenger and Fordtran's Gastrointestinal and Liv.pdb | 2006-06-09 03:54 | 38M | |
| Feldman - Sleisenger & Fordtran's Gastrointestinal and Liver.pdb | 2006-06-08 19:13 | 7.1M | |
| Evans - Oxford Textbook of Geriatric Medicine.pdb | 2006-06-08 19:14 | 15M | |
| Essentials of Radiologic Imaging 7th Ed.pdb | 2006-06-09 04:06 | 22M | |
| Encyclopedia of Cancer, 3rd Edition.pdf | 2020-06-07 12:04 | 87M | |
| Eisenberg - What to Order When Pocket Guide to Diagnostic Im.pdb | 2006-06-02 20:28 | 295K | |
| Duthie - Practice of Geriatrics 3rd ed.pdb | 2006-06-08 10:29 | 5.9M | |
| Duker - Krugman's Infectious Diseases of Children 11th ed.pdb | 2006-06-09 04:04 | 22M | |
| Documentos/ | 2021-01-10 21:22 | - | |
| Detels - Oxford Textbook of Public Health 4th Ed.pdb | 2006-06-09 02:28 | 17M | |
| DeLee and Drez's Orthopaedic Sports Medicine 2nd ed.pdb | 2006-06-09 04:40 | 6.3M | |
| Davison - Oxford Textbook of Clinical Nephrology 2nd ed.pdb | 2006-06-09 04:33 | 54M | |
| Daugirdas - Handbook of Dialysis 3rd ed.pdb | 2006-06-09 04:32 | 4.8M | |
| Danforth's Ob&Gyn 9ed with images.pdb | 2006-06-09 01:58 | 15M | |
| Dale - Infectious Diseases The Clinician's Guide to Diagnosi.pdb | 2006-06-08 22:36 | 10M | |
| Dahnert - Radiology Review Manual 4th - No Images.pdb | 2006-06-09 00:43 | 4.4M | |
| Current Surgical Diagnosis and Treatment 11ed With images.pdb | 2006-06-08 20:53 | 22M | |
| Current Pediatrics 16ed with Images.pdb | 2006-06-08 20:39 | 15M | |
| Current Ob&Gyn 9ed with images.pdb | 2006-06-09 04:17 | 18M | |
| Current MDT 2003 With Images.pdb | 2006-06-09 01:04 | 14M | |
| Current MD&T 2004.pdb | 2006-06-08 11:46 | 5.6M | |
| Current Gastroenterology 2ed with Images.pdb | 2006-06-08 16:50 | 13M | |
| Current Diagnosis & Treatment in Orthopedics 3rd ed with ima.pdb | 2006-06-09 02:38 | 23M | |
| Current Diagnosis & Treatment in Infectious Diseases 1st ed .pdb | 2006-06-09 00:49 | 8.9M | |
| Current Cardiology 2ed with images.pdb | 2006-06-08 19:34 | 9.6M | |
| Cummings - Otolaryngology - Head and Neck Surgery 3rd ed.pdb | 2006-06-09 02:06 | 194M | |
| Concise Encyclopedia of Biostatistics for Medical Professionals.pdf | 2020-06-07 12:03 | 16M | |
| Color Netter Atlas of Human Anatomy.pdb | 2006-06-09 04:40 | 61M | |
| Cohen - Infectious Disease 2nd ed.pdb | 2006-06-09 04:39 | 278M | |
| Clinical Neurology v2.9.pdb | 2006-06-02 21:08 | 338K | |
| Clinical Evidence Vol 10.pdb | 2006-06-09 04:40 | 5.6M | |
| Clinical Evidence Vol 9.pdb | 2006-06-09 02:36 | 4.8M | |
| Cline - Emergency Medicine - A Comprehensive Study Guide Com.pdb | 2006-06-05 22:36 | 5.2M | |
| Cherry & Merkatz's Complications of Pregnancy 5ed.pdb | 2006-06-09 01:24 | 10M | |
| Chen - Manual of Common Bedside Surgical Procedures 2nd ed.pdb | 2006-06-09 04:40 | 3.0M | |
| Chapman - Chapman's Orthopaedic Surgery 3rd ed.pdb | 2006-06-09 04:40 | 109M | |
| Chabner - Cancer Chemotherapy and Biotherapy Principles and .pdb | 2006-06-09 04:40 | 9.6M | |
| Cecil Textbook of Medicine.pdb | 2006-06-09 02:21 | 8.2M | |
| Carpenter - Pediatric and Adolescent Gynecology 2nd Ed.pdb | 2006-06-09 02:47 | 9.9M | |
| Cannon - Critical Pathways in Cardiology 2001.pdb | 2006-06-09 02:29 | 4.7M | |
| Cancer.pdb | 2006-06-09 02:29 | 2.3M | |
| CURRENT Emergency Diagnosis 5th ed 2004.pdb | 2006-06-08 21:57 | 12M | |
| CURRENT Critical Care Diagnosis & Treatment 2nd ed with imag.pdb | 2006-06-08 11:21 | 6.7M | |
| CID 10.pdb | 2006-06-02 14:42 | 283K | |
| Byron - Head and Neck Surgery - Otolaryngology 3rd ed.pdb | 2006-06-09 04:32 | 74M | |
| Buttaravoli and stair - Common Simple Emergencies.pdb | 2006-06-02 09:01 | 509K | |
| Briggs - Drugs in Pregnacy and Lactation 6ed.pdb | 2006-06-09 04:40 | 2.8M | |
| Braverman - Werner and Ingbar's the Thyroid A Fundamental an.pdb | 2006-06-09 03:03 | 15M | |
| Braunwald - Heart Disease - A Textbook of Cardiovascular Med.pdb | 2006-06-05 05:26 | 7.4M | |
| Braunwald - Harrison's Manual of Medicine 15th ed.pdb | 2006-06-09 03:57 | 9.1M | |
| Beutler - Williams Hematology 6th ed.pdb | 2006-06-09 04:39 | 33M | |
| Bergman's Comprehensive Encyclopedia of Human Anatomic Variation.pdf | 2020-06-07 12:04 | 97M | |
| Berger - Principles and Practice of Palliative Care and Supp.pdb | 2006-06-08 20:08 | 12M | |
| Berek Practical Gynecologic Oncology 3ed.pdb | 2006-06-09 03:42 | 12M | |
| Benner & Rector - Benner & Rector's the Kidney 7th ed.pdb | 2006-06-09 04:40 | 150M | |
| Behrman - Nelson Textbook of Pediatrics 17th ed.pdb | 2006-06-09 03:50 | 62M | |
| Becker - Principles and Practice of Endocrinology and Metabo.pdb | 2006-06-09 03:54 | 49M | |
| Baum - Baum's Textbook of Pulmonary Diseases 7th ed.pdb | 2006-06-09 03:51 | 29M | |
| Barash - Clinical Anesthesia 4th ed.pdb | 2006-06-09 04:33 | 28M | |
| Ballantyne - The Massachusetts General Hospital Handbook of .pdb | 2006-06-09 02:59 | 3.1M | |
| Bailey Surgical Textbook.pdb | 2006-06-04 19:47 | 2.2M | |
| Austen - Samter's Immunologic Diseases 6th ed.pdb | 2006-06-08 22:13 | 20M | |
| Auerbach - Wilderness Medicine 4th ed.pdb | 2006-06-09 04:23 | 142M | |
| Armitage - High-Dose Cancer Therapy Pharmacology, Hematopoie.pdb | 2006-06-08 18:09 | 7.3M | |
| Allen - Moss and Adams' Heart Disease in Infants, Children, .pdb | 2006-06-09 03:27 | 33M | |
| Adelman - Manual of Allergy and Immunology Diagnosis and The.pdb | 2006-06-08 16:54 | 4.0M | |
| 1934465135.Clerkship.Directors.in.Internal.Medicine.Internal.Medicine.Essentials.for.Clerkship.Students.2.Sep.2008.pdf | 2011-01-03 21:47 | 2.8M | |
| 1933864621.Demos.Medical.Publishing.The.Dystonia.Patient.A.Guide.to.Practical.Management.Apr.2009.pdf | 2011-01-03 20:38 | 2.4M | |
| 1933864419.Demos.Medical.Publishing.Epilepsy.A.to.Z.A.Concise.Encyclopedia.Mar.2009.pdf | 2011-01-03 23:05 | 6.8M | |
| 1933864362.Demos.Medical.Publishing.Headache.Medicine.Questions.and.Answers.Dec.2008.pdf | 2011-01-03 22:40 | 10M | |
| 1933864222.Demos.Medical.Publishing.Clinical.Pediatric.Neurology.Apr.2009.pdf | 2011-01-03 22:37 | 10M | |
| 1929622724.Current.Clinical.Strategies.Pub.Critical.Care.Medicine.07.Apr.2006.pdf | 2011-01-02 19:02 | 635K | |
| 1900151731.Greenwich.Medical.Media.Textbook.of.Neuroanaesthesia.and.Critical.Care.Jan.2001.pdf | 2011-01-03 10:03 | 7.3M | |
| 1888799811.Demos.Medical.Publishing.Fatigue.in.Multiple.Sclerosis.Mar.2004.pdf | 2011-01-03 04:25 | 605K | |
| 1888799765.Demos.Medical.Publishing.Nursing.Practice.in.Multiple.Sclerosis.A.Core.Curriculum.Jan.2003.pdf | 2011-01-01 07:08 | 1.0M | |
| 1859962424.Informa.HealthCare.Handbook.of.Pediatric.Emergency.Medicine.May.2003.pdf | 2011-01-03 21:30 | 3.3M | |
| 1841101958.Greenwich.Medical.Media.The.Anaesthesia.Science.Viva.Book.Aug.2004.pdf | 2011-01-03 08:13 | 2.9M | |
| 1841101524.Greenwich.Medical.Media.Tracheostomy.A.Multi-Professional.Handbook.Apr.2004.pdf | 2011-01-03 20:55 | 3.6M | |
| 1841101192.Greenwich.Medical.Media.Radiology.for.Anaesthesia.and.Intensive.Care.Nov.2002.pdf | 2011-01-03 23:01 | 7.4M | |
| 1841100722.Greenwich.Medical.Media.Anaesthesia.for.the.High.Risk.Patient.Apr.2002.pdf | 2011-01-03 22:26 | 3.0M | |
| 1841100676.Greenwich.Medical.Media.Anaesthesia.Databook.A.Perioperative.and.Peripartum.Manual.Feb.2001.pdf | 2011-01-03 21:02 | 6.7M | |
| 1605660787.Medical.Information.Science.Reference.Medical.Informatics.in.Obstetrics.and.Gynecology.Oct.2008.pdf | 2011-01-03 22:51 | 7.3M | |
| 1604568615.Nova.Biomedical.Books.Causes.and.Risks.for.Autism.Oct.2008.pdf | 2011-01-03 07:23 | 1.4M | |
| 1598291963.Morgan.and.Claypool.Publishers.Introduction.to.Statistics.for.Biomedical.Engineers.Oct.2007.pdf | 2011-01-03 08:38 | 1.6M | |
| 1598291505.Morgan.and.Claypool.Publishers.Advanced.Probability.Theory.for.Biomedical.Engineers.Nov.2006.pdf | 2011-01-03 09:15 | 854K | |
| 1598291408.Morgan.and.Claypool.Publishers.Intermediate.Probability.Theory.for.Biomedical.Engineers.Nov.2006.pdf | 2011-01-01 05:33 | 944K | |
| 1598290606.Morgan.and.Claypool.Publishers.Basic.Probability.Theory.for.Biomedical.Engineers.Aug.2006.pdf | 2011-01-03 09:47 | 1.0M | |
| 1587060272.Landes.Bioscience.Synthetic.Polymers.for.Biotechnology.and.Medicine.Oct.2002.pdf | 2011-01-01 04:21 | 1.4M | |
| 1560536322.Hanley.&.Belfus.Dictionary.of.Medical.Acronyms.&.Abbreviations.Aug.2004.pdf | 2011-01-03 09:25 | 3.0M | |
| 193260328X.Demos.Medical.Publishing.The.Personal.Care.Attendant.Guide.The.Art.of.Finding.Keeping.or.Being.One.Nov.2006.pdf | 2011-01-03 09:28 | 900K | |
| 0964519119.Maxwell.Publishing.Company.Inc.Maxwell.Quick.Medical.Reference.May.1996.pdf | 2011-01-03 22:09 | 5.6M | |
| 0849396964.Informa.HealthCare.Medical.Immunology.Sixth.Edition.Mar.2007.pdf | 2011-01-03 22:53 | 9.8M | |
| 0849390877.Informa.HealthCare.Mayo.Clinic.Medical.Manual.Jan.2006.pdf | 2011-01-03 08:29 | 3.2M | |
| 0849318114.CRC.Biotechnology.for.Biomedical.Engineers.Mar.2003.pdf | 2011-01-03 09:35 | 3.6M | |
| 0849300649.CRC.Medical.Image.Registration.Jun.2001.pdf | 2011-01-03 22:26 | 7.2M | |
| 0824725794.CRC.Biomedical.Nanotechnology.Apr.2005.pdf | 2011-01-03 22:05 | 3.6M | |
| 0815702760.Brookings.Institution.Press.Digital.Medicine.Health.Care.in.the.Internet.Era.Apr.2009.pdf | 2011-01-03 04:57 | 891K | |
| 0754644596.Ashgate.Medical.Self-Regulation.Oct.2007.pdf | 2011-01-03 08:52 | 1.3M | |
| 0750307331.Taylor.&.Francis.Minimally.Invasive.Medical.Technology.Feb.2001.pdf | 2011-01-03 09:03 | 4.1M | |
| 0597845360.ICON.Health.Publications.Oral.Cancer.-.A.Medical.Dictionary.Bibliography.and.Annotated.Research.Guide.to.Internet.References.Apr.2004.pdf | 2011-01-03 09:21 | 1.6M | |
| 0470279656.For.Dummies.Medical.Terminology.For.Dummies.).Dec.2008.pdf | 2011-01-03 22:59 | 6.4M | |
| 0309076307.National.Academies.Press.Stem.Cells.and.The.Future.Of.Regenerative.Medicine.Jan.2002.pdf | 2011-01-03 09:42 | 4.8M | |
| 012370586X.Academic.Press.A.History.of.Immunology.Second.Edition.Jul.2009.pdf | 2011-01-03 21:58 | 5.8M | |
| 012326460X.Academic.Press.Of.Mice.Men.and.Microbes.Hantavirus.Jan.1999.pdf | 2011-01-03 09:31 | 2.9M | |
|
|---|