![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Deep Space Craft - An Overview of Interplanetary Flight/ | 2010-12-31 13:07 | - | |
![[ ]](/icons/layout.gif) | Carlo Rovelli on Loop Quantum Gravity.pdf | 2019-08-17 17:47 | 392K | |
| R. S. Ball, Great Astronomers.pdf | 2019-08-17 19:52 | 454K | |
| Fox K. - The big bang theory - what it is, where it came from, and why it works.pdf | 2007-12-24 21:53 | 477K | |
| 0309069386.National.Academies.Press.Engineering.Challenges.to.the.Long-Term.Operation.of.the.International.Space.Station.Mar.2000.pdf | 2011-01-03 09:44 | 518K | |
| Townsend P.K. - Black Holes.pdf | 2007-12-24 20:45 | 751K | |
| John Gribbin - White Holes.pdf | 2019-08-17 20:13 | 960K | |
![[IMG]](/icons/image2.gif) | The Deadbeat Universe - Wahlin.djvu | 2019-08-18 00:02 | 1.0M | |
| Cosmology, inflation and the physics of nothing.pdf | 2019-08-17 18:59 | 1.0M | |
| 157356348X.Greenwood.Press.Recent.Advances.and.Issues.in.Astronomy.Jun.2003.pdf | 2011-01-01 08:58 | 1.0M | |
| Mystery of the Tunguska Fireball.pdf | 2019-08-01 18:13 | 1.3M | |
| (ebook) stephen hawking - a brief history of time.pdf | 2006-04-29 09:33 | 1.4M | |
| Mysteries of the Universe.pdf | 2019-08-17 17:23 | 1.6M | |
| 0309101379.National.Academies.Press.Brave.New.Universe.Illuminating.the.Darkest.Secrets.of.the.Cosmos.Aug.2006.pdf | 2011-01-03 09:33 | 1.7M | |
| Gravitational physics. Exploring the structure of space and time.djvu | 2007-12-24 17:16 | 1.8M | |
| The First Three Minutes, A Modern View of the Origin of the Universe - Weinberg.pdf | 2019-08-18 00:20 | 1.8M | |
| 0750304057.Taylor.&.Francis.An.Introduction.to.the.Science.of.Cosmology.Aug.2002.pdf | 2011-01-03 08:14 | 1.8M | |
| An Introduction to the Science of Cosmology.pdf | 2019-08-17 23:01 | 1.8M | |
| 0309071348.National.Academies.Press.Methods.for.Developing.Spacecraft.Water.Expsoure.Guidelines.Jan.2000.pdf | 2011-01-03 07:51 | 2.0M | |
| Tatum J.B. - Celestial mechanics.djvu | 2007-12-24 22:14 | 2.5M | |
| Mukhanov, V. - Physical Foundations of Cosmology (Cambridge ebook, 2005).pdf | 2019-08-17 22:46 | 2.6M | |
| Lucent Library of Science and Technology. Telescopes.pdf | 2007-12-24 22:12 | 2.7M | |
| The Shape of Space - Weeks.djvu | 2019-08-17 23:54 | 2.7M | |
| Tunguska Mystery.pdf | 2019-08-01 18:13 | 2.8M | |
| The Holographic Universe.pdf | 2019-08-17 20:47 | 2.9M | |
| Gauquelin M. - The cosmic clocks From astrology to a modern science.djvu | 2007-12-24 22:15 | 3.0M | |
| The Cosmic Clocks, From Astrology to a Modern Science - Gauquelin.djvu | 2019-08-17 22:48 | 3.0M | |
| Exploration of the Solar System by Infrared Remote Sensing.pdf | 2019-08-01 18:13 | 3.7M | |
| Perfect Symmetry - The Search for the Beginning of Time - H. Pagels.pdf | 2019-08-17 22:49 | 3.8M | |
| The Sun A User's Manual.pdf | 2019-08-01 18:13 | 3.8M | |
| 0750309482.Taylor.&.Francis.Gravitation.From.the.Hubble.Length.to.the.Planck.Length.Oct.2004.pdf | 2011-01-03 09:56 | 4.0M | |
| A Universe from Nothing Why There Is Something Rather than Nothing.pdf | 2019-08-17 21:57 | 4.0M | |
| Lucent Library of Science and Technology. Black Holes.pdf | 2007-12-24 22:10 | 4.0M | |
| 0750306580.Taylor.&.Francis.Very.High.Energy.Gamma-Ray.Astronomy.Apr.2003.pdf | 2011-01-03 22:49 | 4.3M | |
| Mechanism of The Heavens - Somerville (Book I-IV + Critical Reviews).pdf | 2019-08-17 20:23 | 4.4M | |
| 0750308680.Taylor.&.Francis.Astronomically.Speaking.A.Dictionary.of.Quotations.on.Astronomy.and.Physics.Aug.2003.pdf | 2011-01-03 08:19 | 4.9M | |
| Martinez V.J., Saar E. - Statistics of the galaxy distribution.djvu | 2007-12-24 22:12 | 5.1M | |
| Lucent Library of Science and Technology. Space Stations.pdf | 2007-12-24 22:12 | 5.3M | |
| Three Hundred Years of Gravitation - Hawking & Israel.djvu | 2019-08-18 00:15 | 5.4M | |
| Dictionary of geophysics, astrophysics, and astronomy (CRC, 2001)(524s).pdf | 2019-08-17 19:56 | 5.4M | |
| Intro to Space Sciences.pdf | 2019-08-17 22:49 | 5.6M | |
| The Origin and Evolution of the Solar System.pdf | 2019-08-17 22:07 | 5.8M | |
| Finding the Big Bang.pdf | 2019-08-01 18:13 | 6.0M | |
| 0750308109.Taylor.&.Francis.Modern.Cosmology.Dec.2001.pdf | 2011-01-03 09:53 | 6.0M | |
| 0309074061.National.Academies.Press.Connecting.Quarks.with.the.Cosmos.Eleven.Science.Questions.for.the.New.Century.Mar.2003.pdf | 2011-01-03 10:06 | 6.2M | |
| Rau - Astronomy inspired atomic and molecular physics.pdf | 2007-12-24 22:11 | 6.4M | |
| Lucent Library of Science and Technology. Exploring Mars.pdf | 2007-12-24 22:04 | 6.7M | |
| How Apollo Flew to the Moon.pdf | 2019-08-01 18:13 | 7.2M | |
| Planetary Science, The Science of Planets Around Stars - Cole & Woolfson.pdf | 2019-08-17 23:36 | 7.8M | |
| Akasofu - Exploring the Secrets of the Aurora.djvu | 2007-12-24 22:15 | 8.3M | |
| Space Shuttle Columbia.pdf | 2019-08-01 18:13 | 8.4M | |
| 030909724X.National.Academies.Press.Preventing.the.Forward.Contamination.of.Mars.Mar.2006.pdf | 2011-01-03 21:24 | 8.6M | |
| An Introduction to Space Weather .pdf | 2019-08-01 18:13 | 8.9M | |
| The Complete Idiot's Guide to Astronomy, Second Edition.pdf | 2019-08-18 00:16 | 9.0M | |
| Small Bodies in Planetary Systems.pdf | 2019-08-01 18:13 | 9.8M | |
| Catastrophic Events Caused by Cosmic Objects.pdf | 2019-08-01 18:13 | 9.8M | |
| Jupiter & how to observe it.pdf | 2019-08-01 18:13 | 10M | |
| Satellite remote sensing archaeology.pdf | 2019-08-01 18:13 | 10M | |
| Asteroids, Comets and Meteorites.pdf | 2019-08-01 18:13 | 11M | |
| Liddle A. Introduction to modern cosmology (2ed., Wiley, 2003)(189s).pdf | 2019-08-17 23:14 | 11M | |
| The Big Bang Never Happened - serious alternative science.pdf | 2019-08-17 23:11 | 13M | |
| Mars - An Introduction.pdf | 2019-08-01 18:13 | 13M | |
| Salyut - The First Space Station.pdf | 2019-08-01 18:13 | 14M | |
| Black Holes and Time Warps, Einstein's Outrageous Legacy - Thorne.djvu | 2019-08-18 00:20 | 17M | |
| Impact - The Threat of Comets and Asteroids.pdf | 2019-08-01 18:13 | 19M | |
| The Elegant Universe.pdf | 2019-08-17 22:07 | 21M | |
| Essentials of Meteorology.pdf | 2019-08-17 23:09 | 22M | |
| The Surface of Mars.pdf | 2019-08-01 18:13 | 24M | |
| Stephen Hawking - The Universe in a Nutshell.pdf | 2019-08-17 23:34 | 25M | |
| The Fabric of the Cosmos - Space, Time, and the Texture of Reality (Brian Greene).pdf | 2019-08-17 23:40 | 25M | |
| The Story Manned Space Stations.pdf | 2019-08-01 18:13 | 27M | |
| McGraw-Hill - Astronomy Demystified.pdf | 2019-08-18 00:10 | 30M | |
| Hubble 15 Years of Discovery.pdf | 2019-08-01 18:13 | 31M | |
| Philip's Astronomy Encyclopedia.pdf | 2019-08-18 00:20 | 32M | |
| Atlas of Messier Objects.pdf | 2019-08-01 18:13 | 35M | |
| Searching for Water in the Universe.pdf | 2019-08-01 18:13 | 39M | |
| Eclipse- Duncan Steel.pdf | 2019-08-01 18:13 | 40M | |
| Origins - The Quest for Our Cosmic Roots.pdf | 2019-08-18 00:20 | 42M | |
| How_Spacecraft_Fly.pdf | 2019-08-01 18:13 | 45M | |
| Philip's Atlas of the Universe.pdf | 2019-08-18 00:20 | 53M | |
|
|---|