![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Timothy Leary - Psychedelic Prayers.pdf | 2004-05-18 17:30 | 318K | |
![[ ]](/icons/layout.gif) | Kama Sutra(sex book).pdf | 2004-05-19 01:35 | 13M | |
![[DIR]](/icons/folder.gif) | HYPNOTISM/ | 2006-04-30 12:41 | - | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_-_On_Duty.txt | 2009-07-14 11:56 | 16K | |
![[ ]](/icons/unknown.gif) | Aleister_Crowley_-_The_Banned_Lecture.doc | 2009-07-14 11:56 | 43K | |
![[ ]](/icons/unknown.gif) | Aleister_Crowley_-_The_Enochian_Tablets_and_the_Book_of_th.doc | 2009-07-14 11:56 | 71K | |
![[ ]](/icons/unknown.gif) | Aleister_Crowley_-_The_Gospel_According_to_St._Bernard_Sha.wri | 2009-07-14 11:56 | 410K | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_-_The_Great_Drug_Delusion.htm | 2009-07-14 11:56 | 13K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Collected Works, Volume II, Part 3.txt | 2009-07-14 12:17 | 316K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Collected Works, Volume III, Part 1.txt | 2009-07-14 12:17 | 216K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Collected Works, Volume III, Part 2.txt | 2009-07-14 12:17 | 280K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Collected Works, Volume I, Part 3.txt | 2009-07-14 12:25 | 282K | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_-_The_Heart_of_the_Master.txt | 2009-07-14 12:25 | 41K | |
![[ ]](/icons/layout.gif) | Aleister_Crowley_-_The_Necronomicon.pdf | 2009-07-14 12:25 | 647K | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_-_The_Stone_of_Cybele.txt | 2009-07-14 12:25 | 35K | |
![[ ]](/icons/unknown.gif) | Aleister_Crowley_-_The_Temple_of_Solomon_the_King.wri | 2009-07-14 12:25 | 133K | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_The_Enochian_Tablets.txt | 2009-07-14 12:25 | 71K | |
![[ ]](/icons/layout.gif) | Allen Greenfield - A True History of Witchcraft.pdf | 2009-07-14 12:25 | 65K | |
![[IMG]](/icons/image2.gif) | Appendix E-pt 1.jpg | 2009-07-14 12:25 | 41K | |
![[ ]](/icons/unknown.gif) | Book 1 of Wicca.doc | 2009-07-14 12:25 | 275K | |
![[ ]](/icons/unknown.gif) | Book 2 of Wicca.PDF | 2009-07-14 12:25 | 121K | |
![[ ]](/icons/layout.gif) | Borce_T._Gjorgjievski_-_History_of_Western_Magic.pdf | 2009-07-14 12:25 | 87K | |
![[TXT]](/icons/text.gif) | Caliph_Hymenaeus_Alpha_-_Autobiography.txt | 2009-07-14 12:25 | 16K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Collected Works, Volume II, Part 2.txt | 2009-07-14 12:26 | 350K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Collected Works, Volume II, Part 1.txt | 2009-07-14 13:51 | 281K | |
![[TXT]](/icons/text.gif) | ATLANTIS.TXT | 2009-07-14 13:58 | 105K | |
![[TXT]](/icons/text.gif) | Barry_Walker_-_Earth_Rites.htm | 2009-07-14 13:58 | 30K | |
![[ ]](/icons/layout.gif) | Basic_Technologies_of_Witchcraft.pdf | 2009-07-14 13:58 | 24K | |
![[ ]](/icons/layout.gif) | Benjamin Rowe 99 - The Essential Skills of Magick.pdf | 2009-07-14 13:58 | 113K | |
![[TXT]](/icons/text.gif) | Benjamin_Rowe_-_The_Book_Of_The_Archer.TXT | 2009-07-14 13:58 | 20K | |
![[TXT]](/icons/text.gif) | Bill_Heidrick_-_The_Star_Sponge_and_the_Fifty_Gates,_Two_P.txt | 2009-07-14 13:58 | 22K | |
![[ ]](/icons/layout.gif) | Blum.Ralph.The.New.Book.Of.Runes.eBook-EEn.pdf | 2009-07-14 13:58 | 961K | |
![[ ]](/icons/layout.gif) | (ebook - occult) Enochian Magick Reference by Benjamin Row.pdf | 2009-07-14 14:00 | 901K | |
![[ ]](/icons/unknown.gif) | Drugs, alcohol, and the Pagan community.doc | 2009-07-14 14:00 | 33K | |
![[TXT]](/icons/text.gif) | EB - Raymond Buckland - ESP, Witches & UFOsUC - The Best o.txt | 2009-07-14 14:00 | 426K | |
![[ ]](/icons/unknown.gif) | ENGLISH.GEM | 2009-07-14 14:00 | 14K | |
![[ ]](/icons/layout.gif) | Eleusis.pdf | 2009-07-14 14:00 | 61K | |
![[ ]](/icons/unknown.gif) | ebook- A E van Vogt - The Witch.rtf | 2009-07-14 14:00 | 93K | |
![[TXT]](/icons/text.gif) | The_Hon._Charles_A._Legge_-_Findings_of_Fact_and_Conclusio.txt | 2009-07-14 14:37 | 15K | |
![[ ]](/icons/layout.gif) | The Sword of Song.pdf | 2009-07-14 14:40 | 205K | |
![[TXT]](/icons/text.gif) | The_Gardnerian_Book_of_Shadows.txt | 2009-07-14 14:40 | 124K | |
![[ ]](/icons/layout.gif) | [eBook] (occult) A True History of Witchcraft.pdf | 2009-07-14 14:40 | 65K | |
![[ ]](/icons/layout.gif) | A Complete Handbook of Nature Cures.pdf | 2009-07-14 14:40 | 1.3M | |
![[ ]](/icons/unknown.gif) | Magic-White Magic.doc | 2009-07-14 14:42 | 56K | |
![[TXT]](/icons/text.gif) | Magical_Groups.html | 2009-07-14 14:42 | 15K | |
![[ ]](/icons/layout.gif) | Magick - Amazing New Mind Power Secret.pdf | 2009-07-14 14:42 | 15K | |
![[ ]](/icons/unknown.gif) | Magick_and_Hypnosis.doc | 2009-07-14 14:42 | 68K | |
![[ ]](/icons/layout.gif) | Necronomicon Spellbook.pdf | 2009-07-14 14:42 | 104K | |
![[TXT]](/icons/text.gif) | Novus_Ordo_Aureae_Aurora.txt | 2009-07-14 14:42 | 17K | |
![[TXT]](/icons/text.gif) | Piers_Anthony_-_Being_A_Green_Mother.TXT | 2009-07-14 14:42 | 602K | |
![[TXT]](/icons/text.gif) | Ray_Eales_-_Transpersonal_Psychology_and_the_Methods_of_I.html | 2009-07-14 14:42 | 27K | |
![[TXT]](/icons/text.gif) | HIST01.TXT | 2009-07-14 14:44 | 4.5K | |
![[TXT]](/icons/text.gif) | HIST02.TXT | 2009-07-14 14:44 | 3.3K | |
![[TXT]](/icons/text.gif) | HIST03.TXT | 2009-07-14 14:44 | 5.5K | |
![[TXT]](/icons/text.gif) | HIST04.TXT | 2009-07-14 14:44 | 15K | |
![[TXT]](/icons/text.gif) | HIST05.TXT | 2009-07-14 14:44 | 6.8K | |
![[TXT]](/icons/text.gif) | HIST06.TXT | 2009-07-14 14:44 | 7.6K | |
![[TXT]](/icons/text.gif) | HIST07.TXT | 2009-07-14 14:44 | 9.6K | |
![[ ]](/icons/layout.gif) | Henry_Cornelius_Agrippa_-_Of_Geomancy.pdf | 2009-07-14 14:44 | 463K | |
![[ ]](/icons/unknown.gif) | Herbs and their Magical Properties.doc | 2009-07-14 14:44 | 43K | |
![[TXT]](/icons/text.gif) | Hoffman, Alice - Practical_Magic_v1-1.html | 2009-07-14 14:44 | 480K | |
![[ ]](/icons/unknown.gif) | Hypnotism & spells.doc | 2009-07-14 14:44 | 75K | |
![[ ]](/icons/layout.gif) | Cassandra Eason - A Practical Guide to Witchcraft and Magi.pdf | 2009-07-14 14:57 | 1.8M | |
![[TXT]](/icons/text.gif) | Celtic Goddess Text.txt | 2009-07-14 14:57 | 15K | |
![[TXT]](/icons/text.gif) | Charles_G._Leland_-_Aradia,_Gospel_of_the_Witches_(1899).htm | 2009-07-14 14:57 | 168K | |
![[ ]](/icons/unknown.gif) | Chart for Druidic Calendar Month 3.doc | 2009-07-14 14:57 | 8.0K | |
![[ ]](/icons/unknown.gif) | Coelho, Paulo - The Alchemist.lit | 2009-07-14 14:57 | 92K | |
![[IMG]](/icons/image2.gif) | Cover.jpg | 2009-07-14 14:57 | 80K | |
![[ ]](/icons/unknown.gif) | Crafting Ritual Candles.doc | 2009-07-14 14:57 | 47K | |
![[IMG]](/icons/image2.gif) | Appendix E-pt 2.jpg | 2009-07-14 15:00 | 40K | |
![[TXT]](/icons/text.gif) | Arnold-Celtic Literature.htm | 2009-07-14 15:00 | 247K | |
![[TXT]](/icons/text.gif) | Arthur, Keri - DAMASK CIRCLE BOOK - Circle of Fire.txt | 2009-07-14 15:00 | 425K | |
![[TXT]](/icons/text.gif) | Arthur, Keri - Damask Circle Book - Circle of Death.txt | 2009-07-14 15:00 | 435K | |
![[ ]](/icons/layout.gif) | Art of True Healing.pdf | 2009-07-14 15:00 | 52K | |
![[TXT]](/icons/text.gif) | Ritual Magic Workbook part 1 UC.txt | 2009-07-14 15:01 | 244K | |
![[TXT]](/icons/text.gif) | Ritual Magic Workbook part 2 UC.txt | 2009-07-14 15:01 | 373K | |
![[TXT]](/icons/text.gif) | Roger Dearnaley_-_Gardnerian_Chronology_And_Bibliography.htm | 2009-07-14 15:01 | 92K | |
![[TXT]](/icons/text.gif) | Ryan_Parker_-_Rite_Of_The_Ghouls.txt | 2009-07-14 15:01 | 21K | |
![[TXT]](/icons/text.gif) | Sams, Candace - THE ORDER - Gryphon's Quest.txt | 2009-07-14 15:01 | 381K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Collected Works, Volume III, Part 3.txt | 2009-07-14 15:03 | 287K | |
![[ ]](/icons/layout.gif) | Aleister Crowley - Concerning Death.pdf | 2009-07-14 15:03 | 55K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Meditation.txt | 2009-07-14 15:03 | 257K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - The Enochian Tablets.txt | 2009-07-14 15:03 | 71K | |
![[ ]](/icons/layout.gif) | (NLP - seduction) - (ebook) NLP - The Structure Of Magic V.pdf | 2009-07-14 15:04 | 7.8M | |
![[ ]](/icons/layout.gif) | (ebook)Aleister Crowley - Magick in Theory and Practice.pdf | 2009-07-14 15:04 | 1.0M | |
![[ ]](/icons/layout.gif) | the_greater_Key_of_Solomon_1.pdf | 2009-07-14 15:11 | 509K | |
![[ ]](/icons/layout.gif) | the_greater_Key_of_Solomon_2.pdf | 2009-07-14 15:12 | 481K | |
![[ ]](/icons/layout.gif) | the_greater_Key_of_Solomon_3.pdf | 2009-07-14 15:12 | 544K | |
![[ ]](/icons/layout.gif) | The_Library_Of_Knowledge_-_Occult_Magic.pdf | 2009-07-14 15:15 | 584K | |
![[ ]](/icons/layout.gif) | Time.pdf | 2009-07-14 15:15 | 60K | |
![[ ]](/icons/unknown.gif) | White Magic.doc | 2009-07-14 15:15 | 56K | |
![[TXT]](/icons/text.gif) | William R. McGrath, B.A., N.D. - Common Herbs for Common I.txt | 2009-07-14 15:15 | 62K | |
![[ ]](/icons/layout.gif) | Simon_-_The_Necronomicon_Spellbook.pdf | 2009-07-14 15:16 | 104K | |
![[ ]](/icons/unknown.gif) | So_My_Kid_Is_A_Witch.ppt | 2009-07-14 15:16 | 891K | |
![[TXT]](/icons/text.gif) | Spells (Various).txt | 2009-07-14 15:16 | 30K | |
![[ ]](/icons/unknown.gif) | Spells of Magic.doc | 2009-07-14 15:16 | 35K | |
![[ ]](/icons/layout.gif) | The Secret Rituals of the O.T.O.pdf | 2009-07-14 15:18 | 1.0M | |
![[ ]](/icons/layout.gif) | Tannhauser.pdf | 2009-07-14 15:19 | 127K | |
![[ ]](/icons/layout.gif) | Templum 99 - Chaos Magick.pdf | 2009-07-14 15:19 | 8.8K | |
![[ ]](/icons/layout.gif) | Templum 99 - Thelema.pdf | 2009-07-14 15:19 | 8.9K | |
![[ ]](/icons/layout.gif) | Templum Pocket Guide Series 99 - Guide 2 Witchcraft.pdf | 2009-07-14 15:19 | 8.8K | |
![[TXT]](/icons/text.gif) | That_Old_Black_Magick_-_Getting_Specific_about_Magical_Eth.txt | 2009-07-14 15:19 | 28K | |
![[ ]](/icons/unknown.gif) | The 8 Sabbats of Witchcraft.doc | 2009-07-14 15:19 | 189K | |
![[ ]](/icons/layout.gif) | The Art & Meaning of Magic.pdf | 2009-07-14 15:19 | 100K | |
![[ ]](/icons/layout.gif) | The Essential Skills of Magick by Benjamin Rowe.pdf | 2009-07-14 15:19 | 113K | |
![[ ]](/icons/layout.gif) | The Roots of Witchcraft.pdf | 2009-07-14 15:19 | 2.1M | |
![[TXT]](/icons/text.gif) | Illuminatus Trilogy.txt | 2009-07-14 15:19 | 1.6M | |
![[TXT]](/icons/text.gif) | Index_of_the_Golden_Dawn_Course.txt | 2009-07-14 15:19 | 25K | |
![[TXT]](/icons/text.gif) | Julia_Phillips_-_History_Of_Wicca_In_England.txt | 2009-07-14 15:19 | 44K | |
![[ ]](/icons/layout.gif) | K._Amber_-_The_Basics_of_Magick.pdf | 2009-07-14 15:19 | 87K | |
![[ ]](/icons/layout.gif) | Magic and Spells.pdf | 2009-07-14 15:19 | 6.4M | |
![[TXT]](/icons/text.gif) | ACROWLEY.TXT | 2009-07-14 15:20 | 43K | |
![[ ]](/icons/layout.gif) | A Witch Alone.pdf | 2009-07-14 15:20 | 623K | |
![[ ]](/icons/layout.gif) | Aleister Crowley - 1907 diary fragments.pdf | 2009-07-14 15:20 | 55K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Collected Works, Volume I, Part 1.txt | 2009-07-14 15:20 | 285K | |
![[TXT]](/icons/text.gif) | Aleister Crowley - Collected Works, Volume I, Part 2.txt | 2009-07-14 15:20 | 277K | |
![[DIR]](/icons/folder.gif) | wicca/ | 2009-07-14 15:20 | - | |
![[IMG]](/icons/image2.gif) | Fig 01.jpg | 2009-07-14 15:20 | 8.7K | |
![[IMG]](/icons/image2.gif) | Fig 02.jpg | 2009-07-14 15:20 | 4.5K | |
![[ ]](/icons/unknown.gif) | Finding The Craft - story of a witch in recovery.mht | 2009-07-14 15:20 | 98K | |
![[ ]](/icons/layout.gif) | Frater_Achad_-_31_Hymns_to_the_Star_Goddess.pdf | 2009-07-14 15:20 | 161K | |
![[TXT]](/icons/text.gif) | Frater_Achad_-_INRI.htm | 2009-07-14 15:20 | 15K | |
![[TXT]](/icons/text.gif) | Frater_Achad_-_Liber_QNA.htm | 2009-07-14 15:20 | 12K | |
![[ ]](/icons/unknown.gif) | Full Moon Rituals.doc | 2009-07-14 15:20 | 82K | |
![[ ]](/icons/unknown.gif) | Handouts.doc | 2009-07-14 15:20 | 69K | |
![[ ]](/icons/layout.gif) | Healthlibrary.com - A Complete Handbook of Natural Cures.pdf | 2009-07-14 15:20 | 1.3M | |
![[ ]](/icons/layout.gif) | Aleister Crowley - The Necronomicon.pdf | 2009-07-14 15:21 | 647K | |
![[ ]](/icons/unknown.gif) | Aleister_Crowley_-_1907_diary_fragments_(englisch).rtf | 2009-07-14 15:21 | 24K | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_-_Absinthe_The_Green_Goddess.txt | 2009-07-14 15:21 | 31K | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_-_Across_The_Gulf.txt | 2009-07-14 15:21 | 91K | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_-_Aha!.txt | 2009-07-14 15:21 | 47K | |
![[ ]](/icons/unknown.gif) | Aleister_Crowley_-_An_Evocation_of_Bartzabel_-_The_Spirit_.wri | 2009-07-14 15:21 | 23K | |
![[ ]](/icons/unknown.gif) | Aleister_Crowley_-_Astral_Travels_of_1898.wri | 2009-07-14 15:21 | 17K | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_-_Book_of_Lies.txt | 2009-07-14 15:21 | 163K | |
![[ ]](/icons/layout.gif) | Aleister_Crowley_-_Book_of_The_Law.pdf | 2009-07-14 15:21 | 47K | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_-_Cocaine.htm | 2009-07-14 15:21 | 25K | |
![[ ]](/icons/unknown.gif) | Aleister_Crowley_-_Concerning_'Blasphemy'_In_General.wri | 2009-07-14 15:21 | 12K | |
![[ ]](/icons/layout.gif) | Aleister_Crowley_-_Diary_Of_A_Drug_Feind_(Excerpts).pdf | 2009-07-14 15:21 | 229K | |
![[TXT]](/icons/text.gif) | Aleister_Crowley_-_Ethyl_Oxide.htm | 2009-07-14 15:21 | 18K | |
![[ ]](/icons/layout.gif) | Aleister_Crowley_-_Magic_Without_Tears.pdf | 2009-07-14 15:21 | 645K | |
![[ ]](/icons/layout.gif) | 0199236194.Oxford.University.Press.USA.Bodies.of.Thought.Science.Religion.and.the.Soul.in.the.Early.Enlightenment.Sep.2008.pdf | 2010-12-30 15:04 | 1.3M | |
![[ ]](/icons/layout.gif) | 0195168380.Oxford.University.Press.USA.Haunting.the.Buddha.Indian.Popular.Religions.and.the.Formation.of.Buddhism.Sep.2004.pdf | 2010-12-30 16:57 | 3.4M | |
![[ ]](/icons/layout.gif) | 0739119451.Lexington.Books.Sites.of.Violence.Sites.of.Grace.Christian.Nonviolence.and.the.Traumatized.Self.Nov.2008.pdf | 2010-12-30 17:05 | 464K | |
![[ ]](/icons/layout.gif) | 0060762071.HarperOne.Jesus.for.the.Non-Religious.Mar.2007.pdf | 2010-12-31 19:53 | 1.3M | |
![[ ]](/icons/layout.gif) | 0143038338.Penguin.Breaking.the.Spell.Religion.as.a.Natural.Phenomenon.Feb.2007.pdf | 2010-12-31 20:58 | 1.9M | |
![[ ]](/icons/layout.gif) | 0199287147.Oxford.University.Press.USA.The.Re-Emergence.of.Emergence.The.Emergentist.Hypothesis.from.Science.to.Religion.Aug.2006.pdf | 2010-12-31 21:49 | 3.7M | |
![[ ]](/icons/layout.gif) | 0195335988.Oxford.University.Press.USA.Teaching.Religion.and.Film.Aug.2008.pdf | 2010-12-31 22:39 | 1.2M | |
![[ ]](/icons/layout.gif) | 019509106X.Oxford.University.Press.USA.Religion.of.the.Gods.Ritual.Paradox.and.Reflexivity.Feb.2009.pdf | 2010-12-31 23:30 | 6.9M | |
![[ ]](/icons/layout.gif) | 096345742X.The.Golden.Sufi.Center.Travelling.the.Path.of.Love.Sayings.of.Sufi.Masters.Jan.1994.pdf | 2011-01-01 07:59 | 901K | |
![[ ]](/icons/layout.gif) | 0631166963.Blackwell.Pub.A.Concise.Dictionary.of.Classical.Mythology.Oct.1990.pdf | 2011-01-01 08:22 | 9.2M | |
![[ ]](/icons/layout.gif) | 0061146595.HarperOne.Women.of.the.Way.Discovering.2.500.Years.of.Buddhist.Wisdom.Mar.2007.pdf | 2011-01-02 18:02 | 967K | |
![[ ]](/icons/layout.gif) | 0671687875.Simon.&.Schuster.Mind.of.God.Scientific.Basic.for.a.Rational.World.Feb.1992.pdf | 2011-01-03 06:05 | 1.4M | |
![[ ]](/icons/layout.gif) | 0275990974.Praeger.Publishers.Native.North.American.Religious.Traditions.Dancing.for.Life.Nov.2006.pdf | 2011-01-03 08:06 | 2.0M | |
![[ ]](/icons/layout.gif) | 081296618X.Modern.Library.Islam.A.Short.History.Aug.2002.pdf | 2011-01-03 08:38 | 1.9M | |
![[ ]](/icons/layout.gif) | 0664246982.Westminster.John.Knox.Press.The.Evidence.for.Jesus.Feb.1999.pdf | 2011-01-03 09:00 | 5.9M | |
![[ ]](/icons/layout.gif) | 0470019301.For.Dummies.Hypnotherapy.For.Dummies.Sep.2006.pdf | 2011-01-03 09:19 | 2.5M | |
![[ ]](/icons/layout.gif) | 157607806X.ABC-CLIO.Handbook.of.Chinese.Mythology.Aug.2005.pdf | 2011-01-03 09:50 | 3.6M | |
![[ ]](/icons/layout.gif) | 0275987124.Greenwood.Press.Introduction.to.New.and.Alternative.Religions.in.America.[Five.Volumes].Oct.2006.pdf | 2011-01-03 10:08 | 11M | |
![[ ]](/icons/layout.gif) | 0470243805.For.Dummies.Lost.Books.of.the.Bible.For.Dummies.Jun.2008.pdf | 2011-01-03 20:46 | 6.1M | |
![[ ]](/icons/layout.gif) | 0061233501.Harper.Perennial.Finding.Darwins.God.A.Scientists.Search.for.Common.Ground.Between.God.and.Evolution.Apr.2007.pdf | 2011-01-03 20:56 | 2.4M | |
![[ ]](/icons/layout.gif) | 094896443X.Rotographic.Publications.A.Numismatic.Journey.Through.the.Bible.Nov.2007.pdf | 2011-01-03 21:01 | 6.9M | |
![[ ]](/icons/layout.gif) | Book_of_Soyga_8x10.pdf | 2015-12-29 11:56 | 2.6M | |
![[ ]](/icons/unknown.gif) | Encyclopedia of Norse and Germanic Folklore, Mythology, and Magic.epub | 2020-06-07 12:04 | 7.1M | |
![[ ]](/icons/layout.gif) | The Encyclopedia of Taoism 2-volume set.pdf | 2020-06-07 12:04 | 24M | |
![[DIR]](/icons/folder.gif) | Aleister Crowley - The High History of Good Sir Palamedes/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | Aleister Crowley - The Paris Working/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | Aleister_Crowley_-_Not_The_Life_And_Adventures_Of_Sir_Roger/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | Ebooks/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | Margaret_Alice_Murray_-_God_Of_The_Witches_(1933)/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | Miller.Richard.The.Magical.And.Ritual.Use.Of.Herbs.eBook-EEn/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | Reginald Scot's Collection of Magical Texts/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | Richard Alan Miller - Magical and Ritual Use of Herbs/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | Wicca 101/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | Wicca102/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | tea/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | unsorted/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | wicca01/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | wicca02/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | wicca03/ | 2021-01-10 22:00 | - | |
![[DIR]](/icons/folder.gif) | wicca07/ | 2021-01-10 22:00 | - | |
![[ ]](/icons/layout.gif) | Complete Babylonian Talmud (English).pdf | 2024-03-15 00:13 | 54M | |
![[ ]](/icons/layout.gif) | 0892364467 (1).pdf | 2025-02-09 17:26 | 14M | |
![[DIR]](/icons/folder.gif) | religion/ | 2025-02-12 19:00 | - | |
![[DIR]](/icons/folder.gif) | Norse, Celtic Mythology & Runes, 3 books in 1 - Explore The Timeless Tales Of Norse & Celtic Folklore/ | 2025-04-13 12:59 | - | |
![[SND]](/icons/sound2.gif) | Exactly Why Jesus Christ is NOT a Jew.mp3 | 2025-04-24 16:44 | 12M | |
|