![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Edgar Allan Poe.pdf | 2006-04-22 23:21 | 4.4M | |
![[DIR]](/icons/folder.gif) | WWII Archive Photographs PDF E-Book (200 Pictures)/ | 2006-04-23 13:03 | - | |
| Aldous Huxley - The Doors Of Perception.pdf | 2006-04-29 01:33 | 258K | |
| David Icke Books/ | 2006-05-06 12:59 | - | |
![[ ]](/icons/compressed.gif) | Turner, Ursula Payge - The Pitjinaer Tales (htm).zip | 2006-05-11 14:27 | 40K | |
| Thompson, Ruth Plumly - OZ - Gnome King of Oz (txt).zip | 2006-05-11 15:05 | 79K | |
| Tolstoy, Lev - The Devil (pdf).zip | 2006-05-11 15:39 | 93K | |
| Tryon, Tom - Night Magic (htm).zip | 2006-05-11 16:00 | 228K | |
| Thompson, Ruth Plumly - OZ - Jack Pumpkinhead of Oz (txt).zip | 2006-05-11 16:37 | 152K | |
| Trimble, Louis - Wild Horse Range (htm).zip | 2006-05-11 16:42 | 81K | |
| Thomas, Dylan - A Child's Christmas In Wales (lit).zip | 2006-05-11 16:43 | 61K | |
| Thompson, Jim - Wild Town (lit).zip | 2006-05-11 16:43 | 264K | |
| Tey, Josephine - The Franchise Affair (txt).zip | 2006-05-11 17:18 | 185K | |
| Tracy, Marilyn - Extreme Justice (txt).zip | 2006-05-11 17:19 | 158K | |
| Taine, John - The Ultimate Catalyst (rtf).zip | 2006-05-11 17:19 | 24K | |
| Tan, Amy - The Joy Luck Club (lit).zip | 2006-05-11 19:43 | 309K | |
| Tenin, Vlas - Moscow Nights (txt).zip | 2006-05-11 19:58 | 206K | |
| Thorndyke, Russell - The Scarecrow Rides (htm).zip | 2006-05-11 20:32 | 212K | |
| Thoreau, Henry David - Walden and Other Writings (lit).zip | 2006-05-11 23:02 | 518K | |
| Traven, B. - The Treasure of the Sierra Madre (txt).zip | 2006-05-11 23:02 | 246K | |
| Tyrell, Naomi - The Starlet (txt).zip | 2006-05-11 23:02 | 63K | |
| Tolan, Stephanie S. - Who's There (txt).zip | 2006-05-11 23:04 | 88K | |
| Trout, Kilgore - Venus on the Half-Shell (lit).zip | 2006-05-11 23:08 | 492K | |
| Targ, Russell - Limitless Mind (rtf).zip | 2006-05-11 23:09 | 123K | |
| Temple, William F. - The Four-Sided Triangle (rtf).zip | 2006-05-11 23:09 | 24K | |
| Tolstoy, Ilya - Reminiscences of Tolstoy (pdf).zip | 2006-05-11 23:12 | 111K | |
| Trask, Thomas - The Battle - Defeating the Enemy of Your Soul (htm).zip | 2006-05-11 23:21 | 164K | |
| Tobin, Greg - Selecting the Pope (lit).zip | 2006-05-11 23:24 | 605K | |
| Taylor, Truda - The Comte and the Courtesan (txt).zip | 2006-05-11 23:25 | 160K | |
| Thompson, Frank - King Arthur (rtf).zip | 2006-05-11 23:25 | 198K | |
| Tiptree, James Jr. - And So On and So On (rtf).zip | 2006-05-11 23:25 | 4.1K | |
| Turnbull, Peter - York CID - The Woodcarver (rtf).zip | 2006-05-11 23:25 | 13K | |
| Tuchman, Barbara - A Distant Mirror - The Calamitous 14th Century (lit).zip | 2006-05-11 23:33 | 619K | |
| Turley, Charles - Voyages of Captain Scott (lit).zip | 2006-05-11 23:34 | 281K | |
| Thor, Brad - Scot Harvath 03 - State of the Union (lit).zip | 2006-05-11 23:34 | 444K | |
| Tuning, William - Fuzzy Bones (lit).zip | 2006-05-12 01:53 | 397K | |
| Terry Carr's Best Science Fiction of the Year (1984) (htm).zip | 2006-05-12 01:54 | 315K | |
| Thompson, Vicki Lewis - Beyond the Red Doors (htm).zip | 2006-05-12 01:54 | 60K | |
| Taylor, Karen E. - Vampire Legacy 04 - Blood of My Blood (lit).zip | 2006-05-12 03:23 | 214K | |
| Taylor, Roger - Return Of The Sword (lit).zip | 2006-05-12 03:24 | 519K | |
| Tracy, P.J. - Want to Play (htm).zip | 2006-05-12 03:29 | 245K | |
| Tasso, Torquato - Jerusalem Delivered (lit).zip | 2006-05-12 03:29 | 703K | |
| Tey, Josephine - Brat Farrar (rtf).zip | 2006-05-12 03:29 | 181K | |
| Tan, Amy - The Bonesetter's Daughter (lit).zip | 2006-05-12 03:29 | 342K | |
| Tuchman, Barbara - The Guns of August (lit).zip | 2006-05-12 03:30 | 576K | |
| Thackeray, William Makepeace - Vanity Fair (pdf).zip | 2006-05-12 03:31 | 1.4M | |
| Thackeray, William Makepeace - Barry Lyndon (lit).zip | 2006-05-12 03:31 | 448K | |
| Turow, Scott - Personal Injuries (lit).zip | 2006-05-12 03:32 | 439K | |
| Tryon, Thomas - Harvest Home (htm).zip | 2006-05-12 03:40 | 363K | |
| Tubb, E.C/ | 2006-05-12 13:31 | - | |
| Turtledove, Harry/ | 2006-05-12 13:31 | - | |
| Trevanian/ | 2006-05-12 13:31 | - | |
| Tolstoy, Leo/ | 2006-05-12 13:31 | - | |
| Tenn, William/ | 2006-05-12 13:31 | - | |
| Thomas, Craig/ | 2006-05-12 13:31 | - | |
| Taylor, Charles D/ | 2006-05-12 13:31 | - | |
![[TXT]](/icons/text.gif) | Tracked_by_Demonoid_com.txt | 2006-05-14 16:30 | 34 | |
| Zelazny, Roger/ | 2006-05-19 12:33 | - | |
| Wyndham, John/ | 2006-05-19 12:33 | - | |
| Westlake, Donald E/ | 2006-05-19 12:33 | - | |
| Williams, Walter John/ | 2006-05-19 12:33 | - | |
| Williamson, Jack/ | 2006-05-19 12:33 | - | |
| Willis, Connie/ | 2006-05-19 12:33 | - | |
| Wolfe, Gene/ | 2006-05-19 12:33 | - | |
| Vinge, Vernor/ | 2006-05-19 12:33 | - | |
| Vonnegut, Kurt/ | 2006-05-19 12:33 | - | |
| Wall, Anthony/ | 2006-05-19 12:33 | - | |
| Wallace, Edgar/ | 2006-05-19 12:33 | - | |
| Verne, Jules/ | 2006-05-19 12:33 | - | |
| Tzu, Sun/ | 2006-05-19 12:33 | - | |
| Van Vogt, A. E/ | 2006-05-19 12:33 | - | |
| Tsutsui, Yasutaka/ | 2006-05-19 12:33 | - | |
| Sturgeon, Theodore/ | 2006-05-19 12:33 | - | |
| Swigart, Rob/ | 2006-05-19 12:33 | - | |
| Theis, Jim/ | 2006-05-19 12:33 | - | |
| Stevenson, Robert Louis/ | 2006-05-19 12:33 | - | |
| Stewart, George R/ | 2006-05-19 12:33 | - | |
| Stoker, Bram/ | 2006-05-19 12:33 | - | |
| Strugatsky, Arkady and Boris/ | 2006-05-19 12:33 | - | |
| Sterling, Bruce/ | 2006-05-19 12:33 | - | |
| Stephenson, Neal/ | 2006-05-19 12:33 | - | |
| Spinrad, Norman/ | 2006-05-19 12:33 | - | |
| Star Trek/ | 2006-05-19 12:33 | - | |
| Simmons, Dan/ | 2006-05-19 12:33 | - | |
| Smith, Clark Ashton/ | 2006-05-19 12:33 | - | |
| Sheckley, Robert/ | 2006-05-19 12:33 | - | |
| Silverberg, Robert/ | 2006-05-19 12:33 | - | |
| Simak, Cliffard D/ | 2006-05-19 12:33 | - | |
| Shaw, Bob/ | 2006-05-19 12:33 | - | |
| Sawyer, Robert J/ | 2006-05-19 12:33 | - | |
| Schmitz, James/ | 2006-05-19 12:33 | - | |
| Scott, Walter/ | 2006-05-19 12:33 | - | |
| Shakespeare, William/ | 2006-05-19 12:33 | - | |
| Rushkoff, Douglas/ | 2006-05-19 12:33 | - | |
| Rhodan, Perry/ | 2006-05-19 12:33 | - | |
| Richerson, Carrie/ | 2006-05-19 12:33 | - | |
| Robeson, Kenneth/ | 2006-05-19 12:33 | - | |
| Preston, Richard/ | 2006-05-19 12:33 | - | |
| Resnick, Mike/ | 2006-05-19 12:33 | - | |
| Platonov, Andrei/ | 2006-05-19 12:33 | - | |
| Poe, Edgar Allan/ | 2006-05-19 12:33 | - | |
| Pohl, Frederik/ | 2006-05-19 12:33 | - | |
| Oltion, Jerry/ | 2006-05-19 12:33 | - | |
| Orwell, George/ | 2006-05-19 12:33 | - | |
| Osier, Nina/ | 2006-05-19 12:33 | - | |
| Palahniuk, Chuck/ | 2006-05-19 12:33 | - | |
| Palashniuk, Chuck/ | 2006-05-19 12:33 | - | |
| Plante, Brian/ | 2006-05-19 12:33 | - | |
| Norton, Andre/ | 2006-05-19 12:33 | - | |
| Novak,Kate/ | 2006-05-19 12:33 | - | |
| Norman, John/ | 2006-05-19 12:33 | - | |
| Murakami, Ryu/ | 2006-05-19 12:33 | - | |
| Navarro, Yvonne/ | 2006-05-19 12:33 | - | |
| Niven, Larry/ | 2006-05-19 12:33 | - | |
| Moore, C. L/ | 2006-05-19 12:33 | - | |
| Murakami, Haruki/ | 2006-05-19 12:33 | - | |
| McGarry, Terry/ | 2006-05-19 12:33 | - | |
| McGeary, Duncan/ | 2006-05-19 12:33 | - | |
| Miller, Henry/ | 2006-05-19 12:33 | - | |
| Miller, Walter M/ | 2006-05-19 12:33 | - | |
| Mahr, Kurt/ | 2006-05-19 12:33 | - | |
| Malzberg, Barry N/ | 2006-05-19 12:33 | - | |
| Martin, George R R/ | 2006-05-19 12:33 | - | |
| McCaffrey, Anne/ | 2006-05-19 12:33 | - | |
| MacClure, Victor/ | 2006-05-19 12:33 | - | |
| MacLean, Katherine/ | 2006-05-19 12:33 | - | |
| Machiavelli, Niccolo/ | 2006-05-19 12:33 | - | |
| Lewis, Carroll/ | 2006-05-19 12:33 | - | |
| London, Jack/ | 2006-05-19 12:33 | - | |
| Longyear, Barry/ | 2006-05-19 12:33 | - | |
| Lovecraft, H P/ | 2006-05-19 12:33 | - | |
| Lawhead, Stephen/ | 2006-05-19 12:33 | - | |
| Lawrence, D. H/ | 2006-05-19 12:33 | - | |
| LeGuin, Ursula K/ | 2006-05-19 12:33 | - | |
| Leiber, Fritz/ | 2006-05-19 12:33 | - | |
| Lennon, John/ | 2006-05-19 12:33 | - | |
| Lewis, C.S/ | 2006-05-19 12:33 | - | |
| Laumer, Keith/ | 2006-05-19 12:33 | - | |
| Lafferty, R A/ | 2006-05-19 12:33 | - | |
| Landis, Geoffrey/ | 2006-05-19 12:33 | - | |
| Lang, Andrew/ | 2006-05-19 12:33 | - | |
| Koontz, Dean/ | 2006-05-19 12:33 | - | |
| Kurtz, Katherine/ | 2006-05-19 12:33 | - | |
| Kipling, Rudyard/ | 2006-05-19 12:33 | - | |
| Kirchoff, Mary/ | 2006-05-19 12:33 | - | |
| Knight, Damon/ | 2006-05-19 12:33 | - | |
| Knight, Harry Adam/ | 2006-05-19 12:33 | - | |
| Koman, Victor/ | 2006-05-19 12:33 | - | |
| Kelly, J P/ | 2006-05-19 12:33 | - | |
| King, Stephen/ | 2006-05-19 12:33 | - | |
| Jablokov, Alexander/ | 2006-05-19 12:34 | - | |
| Jordan, Robert/ | 2006-05-19 12:34 | - | |
| Hogan, James P/ | 2006-05-19 12:34 | - | |
| Howard, Robert E/ | 2006-05-19 12:34 | - | |
| Howell, Jeff/ | 2006-05-19 12:34 | - | |
| Hubbard, L Ron/ | 2006-05-19 12:34 | - | |
| Hemingway, Ernest/ | 2006-05-19 12:34 | - | |
| Herbert, Frank/ | 2006-05-19 12:34 | - | |
| Heinlein, Robert A/ | 2006-05-19 12:34 | - | |
| Harrison, Harry/ | 2006-05-19 12:34 | - | |
| Grisham, John/ | 2006-05-19 12:34 | - | |
| Gunn, James/ | 2006-05-19 12:34 | - | |
| Haldeman, Joe/ | 2006-05-19 12:34 | - | |
| Hamilton, Peter F/ | 2006-05-19 12:34 | - | |
| Goodkind, Terry/ | 2006-05-19 12:34 | - | |
| Gores, Joe/ | 2006-05-19 12:34 | - | |
| Grant, Charles L/ | 2006-05-19 12:34 | - | |
| Gilman, Carolyn Ives/ | 2006-05-19 12:34 | - | |
| Golding, William/ | 2006-05-19 12:34 | - | |
| Gagne, Stefan/ | 2006-05-19 12:34 | - | |
| Gibson, William/ | 2006-05-19 12:34 | - | |
| Feist, Raymond E/ | 2006-05-19 12:34 | - | |
| Felice, Cynthia/ | 2006-05-19 12:34 | - | |
| Foster, Alan Dean/ | 2006-05-19 12:34 | - | |
| Ellison, Harlan/ | 2006-05-19 12:34 | - | |
| Ellroy, James/ | 2006-05-19 12:34 | - | |
| Emshwiller, Carol/ | 2006-05-19 12:34 | - | |
| Fancher, Jane S/ | 2006-05-19 12:34 | - | |
| Egan, Greg/ | 2006-05-19 12:34 | - | |
| Easton, Tom/ | 2006-05-19 12:34 | - | |
| Eddings, David/ | 2006-05-19 12:34 | - | |
| Dumas, Alexandre/ | 2006-05-19 12:34 | - | |
| Dunsany, Lord/ | 2006-05-19 12:34 | - | |
| Dragonlance/ | 2006-05-19 12:34 | - | |
| Dickson, Gordon/ | 2006-05-19 12:34 | - | |
| Dostoevsky, Fyodor/ | 2006-05-19 12:34 | - | |
| Doyle, Arthur Conan/ | 2006-05-19 12:34 | - | |
| Dick, Philip K/ | 2006-05-19 12:34 | - | |
| Dickens, Charles/ | 2006-05-19 12:34 | - | |
| De Camp, L Sprague/ | 2006-05-19 12:34 | - | |
| Defoe, Daniel/ | 2006-05-19 12:34 | - | |
| Denton, Bradley/ | 2006-05-19 12:34 | - | |
| Daniel, Tony/ | 2006-05-19 12:34 | - | |
| Dann, Jack/ | 2006-05-19 12:34 | - | |
| Davidson, Avram/ | 2006-05-19 12:34 | - | |
| Davis, Jerry/ | 2006-05-19 12:34 | - | |
| Clough, Brenda W/ | 2006-05-19 12:34 | - | |
| Cliff Notes/ | 2006-05-19 12:34 | - | |
| Clarke, Arthur C/ | 2006-05-19 12:34 | - | |
| Chandler, A Bertram/ | 2006-05-19 12:34 | - | |
| Chandler, Raymond/ | 2006-05-19 12:34 | - | |
| Cherryh, C J/ | 2006-05-19 12:34 | - | |
| Chester, Harold/ | 2006-05-19 12:34 | - | |
| Clancy, Tom/ | 2006-05-19 12:34 | - | |
| Carr, Charles/ | 2006-05-19 12:34 | - | |
| Carter, Lin/ | 2006-05-19 12:34 | - | |
| Castaneda, Carlos/ | 2006-05-19 12:34 | - | |
| Burstein, Michael A/ | 2006-05-19 12:34 | - | |
| Butler, Octavia/ | 2006-05-19 12:34 | - | |
| Cadigan, Pat/ | 2006-05-19 12:34 | - | |
| Card, Orson Scott/ | 2006-05-19 12:34 | - | |
| Brooke, Keith/ | 2006-05-19 12:34 | - | |
| Brunner, John/ | 2006-05-19 12:34 | - | |
| Bryant, Edward/ | 2006-05-19 12:34 | - | |
| Buck, Doris P/ | 2006-05-19 12:34 | - | |
| Budrys, Algis/ | 2006-05-19 12:34 | - | |
| Burroughs, Edgar Rice/ | 2006-05-19 12:34 | - | |
| Brenchley, Chaz/ | 2006-05-19 12:34 | - | |
| Bischoff, David/ | 2006-05-19 12:34 | - | |
| Blish, James/ | 2006-05-19 12:34 | - | |
| Bone, J F/ | 2006-05-19 12:34 | - | |
| Bova, Ben/ | 2006-05-19 12:34 | - | |
| Bradbury, Ray/ | 2006-05-19 12:34 | - | |
| Bigge, Jerome/ | 2006-05-19 12:34 | - | |
| Bester, Alfred/ | 2006-05-19 12:34 | - | |
| Benford, Gregory/ | 2006-05-19 12:34 | - | |
| Bear, Greg/ | 2006-05-19 12:34 | - | |
| Baum, Frank/ | 2006-05-19 12:34 | - | |
| Barlow, C S/ | 2006-05-19 12:34 | - | |
| Barrie, James Matthew/ | 2006-05-19 12:34 | - | |
| Bates, Harry/ | 2006-05-19 12:34 | - | |
| Badger, J E/ | 2006-05-19 12:34 | - | |
| Ballard, J G/ | 2006-05-19 12:34 | - | |
| Banks, Iain/ | 2006-05-19 12:34 | - | |
| Barley, Barrington J/ | 2006-05-19 12:34 | - | |
| Bach, Richard/ | 2006-05-19 12:34 | - | |
| Astor, JJ/ | 2006-05-19 12:35 | - | |
| Austen, Jane/ | 2006-05-19 12:35 | - | |
| Asprin, Robert/ | 2006-05-19 12:35 | - | |
| Asimov, Isaac/ | 2006-05-19 12:35 | - | |
| Arnold, H F/ | 2006-05-19 12:35 | - | |
| Appleton, Victor/ | 2006-05-19 12:35 | - | |
| Arnold, Edwin/ | 2006-05-19 12:35 | - | |
| Anthony, Piers/ | 2006-05-19 12:35 | - | |
| Anonymous/ | 2006-05-19 12:35 | - | |
| Alshinn, Ellaine M/ | 2006-05-19 12:35 | - | |
| Anderson, Charles D/ | 2006-05-19 12:35 | - | |
| Anderson, Poul/ | 2006-05-19 12:35 | - | |
| Allingham, William/ | 2006-05-19 12:35 | - | |
| Aldiss, Brian/ | 2006-05-19 12:35 | - | |
| Alcott, Louisa May/ | 2006-05-19 12:35 | - | |
| Aesop/ | 2006-05-19 12:35 | - | |
| Abbott, Edwin A/ | 2006-05-19 12:35 | - | |
| Adams, Douglas/ | 2006-05-19 12:35 | - | |
| Tilley, Patrick/ | 2006-05-19 13:09 | - | |
| Tolkien, J.R.R/ | 2006-05-19 13:09 | - | |
| Twain, Mark/ | 2006-05-19 13:09 | - | |
| Varley, John/ | 2006-06-01 21:44 | - | |
| Weis, Margaret/ | 2006-06-01 21:44 | - | |
| Wells, H.G/ | 2006-06-01 21:44 | - | |
| Stith, John E/ | 2006-06-01 21:44 | - | |
| Senn, Steve/ | 2006-06-01 21:44 | - | |
| Salinger, J.D/ | 2006-06-01 21:44 | - | |
| Salvatore, R.A/ | 2006-06-01 21:44 | - | |
| Sammons, Martha C/ | 2006-06-01 21:44 | - | |
| Sagan, Carl/ | 2006-06-01 21:44 | - | |
| Rester, Alfred/ | 2006-06-01 21:44 | - | |
| Robinson, Kim Stanley/ | 2006-06-01 21:44 | - | |
| Robinson, Spider/ | 2006-06-01 21:44 | - | |
| Rowling, J.K/ | 2006-06-01 21:44 | - | |
| Pratchett, Terry/ | 2006-06-01 21:44 | - | |
| Crichton, Michael/ | 2008-04-05 14:17 | - | |
| Thompson, Hunter/ | 2008-05-04 16:34 | - | |
| Matheson, Richard/ | 2008-07-12 03:06 | - | |
| Grimms Fairy Tales/ | 2009-03-17 20:21 | - | |
| Margaret Atwood - 11 novels/ | 2010-04-02 03:36 | - | |
| The Conquest Of Bread.pdf | 2015-01-12 18:00 | 547K | |
| Zen and the Art of Motorcycle Maintenanc - Robert M. Pirsig - [Qwerty80]/ | 2016-09-30 09:19 | - | |
![[ ]](/icons/unknown.gif) | Mein Kampf.epub | 2018-10-15 21:35 | 816K | |
| Reddit's Favorite Books Part1/ | 2018-10-23 00:56 | - | |
| We_2.pdf | 2019-04-18 01:15 | 11M | |
| The Gulag Archipelago/ | 2019-12-29 23:23 | - | |
| Wyndham, John & Edmund, Morris - the Day of the Triffids (2012).epub | 2020-01-07 21:13 | 329K | |
| Atwood, Margaret/ | 2020-06-07 11:51 | - | |
| Ginsberg, Allen/ | 2020-06-07 11:52 | - | |
| Larkin, Philip/ | 2020-06-07 11:53 | - | |
| Brecht, Bertolt/ | 2020-06-07 11:53 | - | |
| Tsvetaeva, Marina/ | 2020-06-07 11:58 | - | |
| Blake, William/ | 2020-06-07 11:59 | - | |
| Keats, John/ | 2020-06-07 12:01 | - | |
| Poetry Pack - Homer, Hesiod, Lucretius, Virgil, Ovid, Dante/ | 2020-06-07 12:13 | - | |
| Geoffrey Chaucer - The Canterbury Tales [96]/ | 2020-06-07 12:18 | - | |
| Milton, John/ | 2020-06-07 12:42 | - | |
| Plath, Sylvia/ | 2020-06-07 12:51 | - | |
| Heine, Heinrich/ | 2020-06-07 12:52 | - | |
| Solzhenitsyn, Aleksandr - In the First Circle [Derek Perkins]/ | 2021-11-03 12:04 | - | |
| MarsProject.pdf | 2022-01-20 15:28 | 46M | |
| Huxley, Aldous/ | 2022-09-16 19:29 | - | |
| Young-Doctor.pdf | 2023-07-28 03:14 | 198K | |
| _OceanofPDF.com_The_Turner_Diaries_-_William_Luther_Pierce.pdf | 2023-12-24 00:20 | 1.2M | |
| _OceanofPDF.com_Hard_to_Be_a_God_-_Arkady_Strugatsky.pdf | 2025-02-20 01:59 | 1.7M | |
| _OceanofPDF.com_Hard_to_Be_a_God_-_Arkadi_Strugatsky.pdf | 2025-02-20 15:55 | 2.6M | |
|
|---|